BioThings Explorer TRAPI Query Graph Handler
A on-the-fly query engine for BioThings Explorer based on TRAPI Query Graph.
Install
npm i @biothings-explorer/query_graph_handler
Usage
Making a single hop query
const handler = require("@biothings-explorer/query_graph_handler");
const queryHandler = new handler.TRAPIQueryHandler();
const oneHopQuery = {
"workflow": [
{"id": "lookup"}
],
"message": {
"query_graph": {
"edges": {
"e00": {
"object": "n01",
"subject": "n00",
"predicates": ["biolink:functional_association"]
}
},
"nodes": {
"n00": {
"categories": ["biolink:Gene"],
"ids": ["ENSEMBL:ENSG00000123374"]
},
"n01": {
"categories": ["biolink:BiologicalProcess"]
}
}
}
}
};
queryHandler.setQueryGraph(OneHopQuery);
await queryHandler.query();
console.log(queryHandler.getResponse())
Example Result
{
"workflow": [
{"id": "lookup"}
],
"message": {
"query_graph": {
"edges": {
"e00": {
"object": "n01",
"subject": "n00",
"predicate": "biolink:enables"
}
},
"nodes": {
"n00": {
"category": "biolink:Gene",
"id": "ENSEMBL:ENSG00000123374"
},
"n01": {
"category": "biolink:BiologicalProcess"
}
}
},
"knowledge_graph": {
"nodes": {
"NCBIGene:1017": {
"category": "biolink:Gene",
"name": "CDK2",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:1017",
"name:cyclin dependent kinase 2",
"SYMBOL:CDK2",
"UMLS:C1332733",
"UMLS:C0108855",
"HGNC:1771",
"UniProtKB:P24941",
"ENSEMBL:ENSG00000123374",
"OMIM:116953"
],
"type": "biolink:id"
}
]
},
"GO:0000082": {
"category": "biolink:BiologicalProcess",
"name": "G1/S transition of mitotic cell cycle",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"GO:0000082",
"name:G1/S transition of mitotic cell cycle"
],
"type": "biolink:id"
}
]
},
"GO:0000086": {
"category": "biolink:BiologicalProcess",
"name": "G2/M transition of mitotic cell cycle",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"GO:0000086",
"name:G2/M transition of mitotic cell cycle"
],
"type": "biolink:id"
}
]
},
"GO:0006260": {
"category": "biolink:BiologicalProcess",
"name": "DNA replication",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"GO:0006260",
"name:DNA replication"
],
"type": "biolink:id"
}
]
},
"GO:0006281": {
"category": "biolink:BiologicalProcess",
"name": "DNA repair",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"GO:0006281",
"name:DNA repair"
],
"type": "biolink:id"
}
]
},
"GO:0006468": {
"category": "biolink:BiologicalProcess",
"name": "protein phosphorylation",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"GO:0006468",
"name:protein phosphorylation"
],
"type": "biolink:id"
}
]
},
"GO:0006977": {
"category": "biolink:BiologicalProcess",
"name": "DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"GO:0006977",
"name:DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest"
],
"type": "biolink:id"
}
]
},
"GO:0007099": {
"category": "biolink:BiologicalProcess",
"name": "centriole replication",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"GO:0007099",
"name:centriole replication"
],
"type": "biolink:id"
}
]
},
"GO:0007165": {
"category": "biolink:BiologicalProcess",
"name": "signal transduction",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"GO:0007165",
"name:signal transduction"
],
"type": "biolink:id"
}
]
},
"GO:0007265": {
"category": "biolink:BiologicalProcess",
"name": "Ras protein signal transduction",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"GO:0007265",
"name:Ras protein signal transduction"
],
"type": "biolink:id"
}
]
},
"GO:0008284": {
"category": "biolink:BiologicalProcess",
"name": "positive regulation of cell population proliferation",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"GO:0008284",
"name:positive regulation of cell population proliferation"
],
"type": "biolink:id"
}
]
},
"GO:0010389": {
"category": "biolink:BiologicalProcess",
"name": "regulation of G2/M transition of mitotic cell cycle",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"GO:0010389",
"name:regulation of G2/M transition of mitotic cell cycle"
],
"type": "biolink:id"
}
]
},
"GO:0010468": {
"category": "biolink:BiologicalProcess",
"name": "regulation of gene expression",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"GO:0010468",
"name:regulation of gene expression"
],
"type": "biolink:id"
}
]
},
"GO:0016572": {
"category": "biolink:BiologicalProcess",
"name": "histone phosphorylation",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"GO:0016572",
"name:histone phosphorylation"
],
"type": "biolink:id"
}
]
},
"GO:0018105": {
"category": "biolink:BiologicalProcess",
"name": "peptidyl-serine phosphorylation",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"GO:0018105",
"name:peptidyl-serine phosphorylation"
],
"type": "biolink:id"
}
]
},
"GO:0031145": {
"category": "biolink:BiologicalProcess",
"name": "anaphase-promoting complex-dependent catabolic process",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"GO:0031145",
"name:anaphase-promoting complex-dependent catabolic process"
],
"type": "biolink:id"
}
]
},
"GO:0031571": {
"category": "biolink:BiologicalProcess",
"name": "mitotic G1 DNA damage checkpoint",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"GO:0031571",
"name:mitotic G1 DNA damage checkpoint"
],
"type": "biolink:id"
}
]
},
"GO:0051298": {
"category": "biolink:BiologicalProcess",
"name": "centrosome duplication",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"GO:0051298",
"name:centrosome duplication"
],
"type": "biolink:id"
}
]
},
"GO:0051301": {
"category": "biolink:BiologicalProcess",
"name": "cell division",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"GO:0051301",
"name:cell division"
],
"type": "biolink:id"
}
]
},
"GO:0051321": {
"category": "biolink:BiologicalProcess",
"name": "meiotic cell cycle",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"GO:0051321",
"name:meiotic cell cycle"
],
"type": "biolink:id"
}
]
},
"GO:0060968": {
"category": "biolink:BiologicalProcess",
"name": "regulation of gene silencing",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"GO:0060968",
"name:regulation of gene silencing"
],
"type": "biolink:id"
}
]
},
"GO:0071732": {
"category": "biolink:BiologicalProcess",
"name": "cellular response to nitric oxide",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"GO:0071732",
"name:cellular response to nitric oxide"
],
"type": "biolink:id"
}
]
},
"GO:1901796": {
"category": "biolink:BiologicalProcess",
"name": "regulation of signal transduction by p53 class mediator",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"GO:1901796",
"name:regulation of signal transduction by p53 class mediator"
],
"type": "biolink:id"
}
]
}
},
"edges": {
"NCBIGene:1017-GO:0000082-MyGene.info API-entrez": {
"predicate": "biolink:enables",
"subject": "NCBIGene:1017",
"object": "GO:0000082",
"attributes": [
{
"name": "provided_by",
"value": "entrez",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "MyGene.info API",
"type": "bts:api"
},
{
"name": "evidence",
"value": "IBA",
"type": "bts:evidence"
},
{
"name": "term",
"value": "G1/S transition of mitotic cell cycle",
"type": "bts:term"
},
{
"name": "publications",
"value": [
"PMID:21873635"
],
"type": "biolink:publications"
}
]
},
"NCBIGene:1017-GO:0000086-MyGene.info API-entrez": {
"predicate": "biolink:enables",
"subject": "NCBIGene:1017",
"object": "GO:0000086",
"attributes": [
{
"name": "provided_by",
"value": "entrez",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "MyGene.info API",
"type": "bts:api"
},
{
"name": "evidence",
"value": "NAS",
"type": "bts:evidence"
},
{
"name": "term",
"value": "G2/M transition of mitotic cell cycle",
"type": "bts:term"
},
{
"name": "publications",
"value": [
"PMID:1653904"
],
"type": "biolink:publications"
}
]
},
"NCBIGene:1017-GO:0006260-MyGene.info API-entrez": {
"predicate": "biolink:enables",
"subject": "NCBIGene:1017",
"object": "GO:0006260",
"attributes": [
{
"name": "provided_by",
"value": "entrez",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "MyGene.info API",
"type": "bts:api"
},
{
"name": "evidence",
"value": "TAS",
"type": "bts:evidence"
},
{
"name": "term",
"value": "DNA replication",
"type": "bts:term"
},
{
"name": "publications",
"value": [
"PMID:19238148"
],
"type": "biolink:publications"
}
]
},
"NCBIGene:1017-GO:0006281-MyGene.info API-entrez": {
"predicate": "biolink:enables",
"subject": "NCBIGene:1017",
"object": "GO:0006281",
"attributes": [
{
"name": "provided_by",
"value": "entrez",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "MyGene.info API",
"type": "bts:api"
},
{
"name": "evidence",
"value": "IEA",
"type": "bts:evidence"
},
{
"name": "term",
"value": "DNA repair",
"type": "bts:term"
}
]
},
"NCBIGene:1017-GO:0006468-MyGene.info API-entrez": {
"predicate": "biolink:enables",
"subject": "NCBIGene:1017",
"object": "GO:0006468",
"attributes": [
{
"name": "provided_by",
"value": "entrez",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "MyGene.info API",
"type": "bts:api"
},
{
"name": "evidence",
"value": "IBA",
"type": "bts:evidence"
},
{
"name": "term",
"value": "protein phosphorylation",
"type": "bts:term"
},
{
"name": "publications",
"value": [
"PMID:21873635"
],
"type": "biolink:publications"
}
]
},
"NCBIGene:1017-GO:0006977-MyGene.info API-entrez": {
"predicate": "biolink:enables",
"subject": "NCBIGene:1017",
"object": "GO:0006977",
"attributes": [
{
"name": "provided_by",
"value": "entrez",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "MyGene.info API",
"type": "bts:api"
},
{
"name": "evidence",
"value": "TAS",
"type": "bts:evidence"
},
{
"name": "term",
"value": "DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest",
"type": "bts:term"
}
]
},
"NCBIGene:1017-GO:0007099-MyGene.info API-entrez": {
"predicate": "biolink:enables",
"subject": "NCBIGene:1017",
"object": "GO:0007099",
"attributes": [
{
"name": "provided_by",
"value": "entrez",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "MyGene.info API",
"type": "bts:api"
},
{
"name": "evidence",
"value": "IMP",
"type": "bts:evidence"
},
{
"name": "term",
"value": "centriole replication",
"type": "bts:term"
},
{
"name": "publications",
"value": [
"PMID:26297806"
],
"type": "biolink:publications"
}
]
},
"NCBIGene:1017-GO:0007165-MyGene.info API-entrez": {
"predicate": "biolink:enables",
"subject": "NCBIGene:1017",
"object": "GO:0007165",
"attributes": [
{
"name": "provided_by",
"value": "entrez",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "MyGene.info API",
"type": "bts:api"
},
{
"name": "evidence",
"value": "IBA",
"type": "bts:evidence"
},
{
"name": "term",
"value": "signal transduction",
"type": "bts:term"
},
{
"name": "publications",
"value": [
"PMID:21873635"
],
"type": "biolink:publications"
}
]
},
"NCBIGene:1017-GO:0007265-MyGene.info API-entrez": {
"predicate": "biolink:enables",
"subject": "NCBIGene:1017",
"object": "GO:0007265",
"attributes": [
{
"name": "provided_by",
"value": "entrez",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "MyGene.info API",
"type": "bts:api"
},
{
"name": "evidence",
"value": "IEP",
"type": "bts:evidence"
},
{
"name": "term",
"value": "Ras protein signal transduction",
"type": "bts:term"
},
{
"name": "publications",
"value": [
"PMID:9054499"
],
"type": "biolink:publications"
}
]
},
"NCBIGene:1017-GO:0008284-MyGene.info API-entrez": {
"predicate": "biolink:enables",
"subject": "NCBIGene:1017",
"object": "GO:0008284",
"attributes": [
{
"name": "provided_by",
"value": "entrez",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "MyGene.info API",
"type": "bts:api"
},
{
"name": "evidence",
"value": "IBA",
"type": "bts:evidence"
},
{
"name": "term",
"value": "positive regulation of cell population proliferation",
"type": "bts:term"
},
{
"name": "publications",
"value": [
"PMID:21873635"
],
"type": "biolink:publications"
}
]
},
"NCBIGene:1017-GO:0010389-MyGene.info API-entrez": {
"predicate": "biolink:enables",
"subject": "NCBIGene:1017",
"object": "GO:0010389",
"attributes": [
{
"name": "provided_by",
"value": "entrez",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "MyGene.info API",
"type": "bts:api"
},
{
"name": "evidence",
"value": "IBA",
"type": "bts:evidence"
},
{
"name": "term",
"value": "regulation of G2/M transition of mitotic cell cycle",
"type": "bts:term"
},
{
"name": "publications",
"value": [
"PMID:21873635"
],
"type": "biolink:publications"
}
]
},
"NCBIGene:1017-GO:0010468-MyGene.info API-entrez": {
"predicate": "biolink:enables",
"subject": "NCBIGene:1017",
"object": "GO:0010468",
"attributes": [
{
"name": "provided_by",
"value": "entrez",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "MyGene.info API",
"type": "bts:api"
},
{
"name": "evidence",
"value": "IBA",
"type": "bts:evidence"
},
{
"name": "term",
"value": "regulation of gene expression",
"type": "bts:term"
},
{
"name": "publications",
"value": [
"PMID:21873635"
],
"type": "biolink:publications"
}
]
},
"NCBIGene:1017-GO:0016572-MyGene.info API-entrez": {
"predicate": "biolink:enables",
"subject": "NCBIGene:1017",
"object": "GO:0016572",
"attributes": [
{
"name": "provided_by",
"value": "entrez",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "MyGene.info API",
"type": "bts:api"
},
{
"name": "evidence",
"value": "IDA",
"type": "bts:evidence"
},
{
"name": "term",
"value": "histone phosphorylation",
"type": "bts:term"
},
{
"name": "publications",
"value": [
"PMID:11746698"
],
"type": "biolink:publications"
}
]
},
"NCBIGene:1017-GO:0018105-MyGene.info API-entrez": {
"predicate": "biolink:enables",
"subject": "NCBIGene:1017",
"object": "GO:0018105",
"attributes": [
{
"name": "provided_by",
"value": "entrez",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "MyGene.info API",
"type": "bts:api"
},
{
"name": "evidence",
"value": "IDA",
"type": "bts:evidence"
},
{
"name": "term",
"value": "peptidyl-serine phosphorylation",
"type": "bts:term"
},
{
"name": "publications",
"value": [
"PMID:23184662"
],
"type": "biolink:publications"
}
]
},
"NCBIGene:1017-GO:0031145-MyGene.info API-entrez": {
"predicate": "biolink:enables",
"subject": "NCBIGene:1017",
"object": "GO:0031145",
"attributes": [
{
"name": "provided_by",
"value": "entrez",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "MyGene.info API",
"type": "bts:api"
},
{
"name": "evidence",
"value": "TAS",
"type": "bts:evidence"
},
{
"name": "term",
"value": "anaphase-promoting complex-dependent catabolic process",
"type": "bts:term"
}
]
},
"NCBIGene:1017-GO:0031571-MyGene.info API-entrez": {
"predicate": "biolink:enables",
"subject": "NCBIGene:1017",
"object": "GO:0031571",
"attributes": [
{
"name": "provided_by",
"value": "entrez",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "MyGene.info API",
"type": "bts:api"
},
{
"name": "evidence",
"value": "TAS",
"type": "bts:evidence"
},
{
"name": "term",
"value": "mitotic G1 DNA damage checkpoint",
"type": "bts:term"
},
{
"name": "publications",
"value": [
"PMID:21319273"
],
"type": "biolink:publications"
}
]
},
"NCBIGene:1017-GO:0051298-MyGene.info API-entrez": {
"predicate": "biolink:enables",
"subject": "NCBIGene:1017",
"object": "GO:0051298",
"attributes": [
{
"name": "provided_by",
"value": "entrez",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "MyGene.info API",
"type": "bts:api"
},
{
"name": "evidence",
"value": "TAS",
"type": "bts:evidence"
},
{
"name": "term",
"value": "centrosome duplication",
"type": "bts:term"
},
{
"name": "publications",
"value": [
"PMID:19238148"
],
"type": "biolink:publications"
}
]
},
"NCBIGene:1017-GO:0051301-MyGene.info API-entrez": {
"predicate": "biolink:enables",
"subject": "NCBIGene:1017",
"object": "GO:0051301",
"attributes": [
{
"name": "provided_by",
"value": "entrez",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "MyGene.info API",
"type": "bts:api"
},
{
"name": "evidence",
"value": "IEA",
"type": "bts:evidence"
},
{
"name": "term",
"value": "cell division",
"type": "bts:term"
}
]
},
"NCBIGene:1017-GO:0051321-MyGene.info API-entrez": {
"predicate": "biolink:enables",
"subject": "NCBIGene:1017",
"object": "GO:0051321",
"attributes": [
{
"name": "provided_by",
"value": "entrez",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "MyGene.info API",
"type": "bts:api"
},
{
"name": "evidence",
"value": "TAS",
"type": "bts:evidence"
},
{
"name": "term",
"value": "meiotic cell cycle",
"type": "bts:term"
},
{
"name": "publications",
"value": [
"PMID:19238148"
],
"type": "biolink:publications"
}
]
},
"NCBIGene:1017-GO:0060968-MyGene.info API-entrez": {
"predicate": "biolink:enables",
"subject": "NCBIGene:1017",
"object": "GO:0060968",
"attributes": [
{
"name": "provided_by",
"value": "entrez",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "MyGene.info API",
"type": "bts:api"
},
{
"name": "evidence",
"value": "IDA",
"type": "bts:evidence"
},
{
"name": "term",
"value": "regulation of gene silencing",
"type": "bts:term"
},
{
"name": "publications",
"value": [
"PMID:20935635"
],
"type": "biolink:publications"
}
]
},
"NCBIGene:1017-GO:0071732-MyGene.info API-entrez": {
"predicate": "biolink:enables",
"subject": "NCBIGene:1017",
"object": "GO:0071732",
"attributes": [
{
"name": "provided_by",
"value": "entrez",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "MyGene.info API",
"type": "bts:api"
},
{
"name": "evidence",
"value": "TAS",
"type": "bts:evidence"
},
{
"name": "term",
"value": "cellular response to nitric oxide",
"type": "bts:term"
},
{
"name": "publications",
"value": [
"PMID:20079829"
],
"type": "biolink:publications"
}
]
},
"NCBIGene:1017-GO:1901796-MyGene.info API-entrez": {
"predicate": "biolink:enables",
"subject": "NCBIGene:1017",
"object": "GO:1901796",
"attributes": [
{
"name": "provided_by",
"value": "entrez",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "MyGene.info API",
"type": "bts:api"
},
{
"name": "evidence",
"value": "TAS",
"type": "bts:evidence"
},
{
"name": "term",
"value": "regulation of signal transduction by p53 class mediator",
"type": "bts:term"
}
]
}
}
},
"results": [
{
"node_bindings": {
"n00": [
{
"id": "NCBIGene:1017"
}
],
"n01": [
{
"id": "GO:0000082"
}
]
},
"edge_bindings": {
"e00": [
{
"id": "NCBIGene:1017-GO:0000082-MyGene.info API-entrez"
}
]
}
},
{
"node_bindings": {
"n00": [
{
"id": "NCBIGene:1017"
}
],
"n01": [
{
"id": "GO:0000082"
}
]
},
"edge_bindings": {
"e00": [
{
"id": "NCBIGene:1017-GO:0000082-MyGene.info API-entrez"
}
]
}
},
{
"node_bindings": {
"n00": [
{
"id": "NCBIGene:1017"
}
],
"n01": [
{
"id": "GO:0000086"
}
]
},
"edge_bindings": {
"e00": [
{
"id": "NCBIGene:1017-GO:0000086-MyGene.info API-entrez"
}
]
}
},
{
"node_bindings": {
"n00": [
{
"id": "NCBIGene:1017"
}
],
"n01": [
{
"id": "GO:0000086"
}
]
},
"edge_bindings": {
"e00": [
{
"id": "NCBIGene:1017-GO:0000086-MyGene.info API-entrez"
}
]
}
},
{
"node_bindings": {
"n00": [
{
"id": "NCBIGene:1017"
}
],
"n01": [
{
"id": "GO:0006260"
}
]
},
"edge_bindings": {
"e00": [
{
"id": "NCBIGene:1017-GO:0006260-MyGene.info API-entrez"
}
]
}
},
{
"node_bindings": {
"n00": [
{
"id": "NCBIGene:1017"
}
],
"n01": [
{
"id": "GO:0006281"
}
]
},
"edge_bindings": {
"e00": [
{
"id": "NCBIGene:1017-GO:0006281-MyGene.info API-entrez"
}
]
}
},
{
"node_bindings": {
"n00": [
{
"id": "NCBIGene:1017"
}
],
"n01": [
{
"id": "GO:0006468"
}
]
},
"edge_bindings": {
"e00": [
{
"id": "NCBIGene:1017-GO:0006468-MyGene.info API-entrez"
}
]
}
},
{
"node_bindings": {
"n00": [
{
"id": "NCBIGene:1017"
}
],
"n01": [
{
"id": "GO:0006468"
}
]
},
"edge_bindings": {
"e00": [
{
"id": "NCBIGene:1017-GO:0006468-MyGene.info API-entrez"
}
]
}
},
{
"node_bindings": {
"n00": [
{
"id": "NCBIGene:1017"
}
],
"n01": [
{
"id": "GO:0006468"
}
]
},
"edge_bindings": {
"e00": [
{
"id": "NCBIGene:1017-GO:0006468-MyGene.info API-entrez"
}
]
}
},
{
"node_bindings": {
"n00": [
{
"id": "NCBIGene:1017"
}
],
"n01": [
{
"id": "GO:0006977"
}
]
},
"edge_bindings": {
"e00": [
{
"id": "NCBIGene:1017-GO:0006977-MyGene.info API-entrez"
}
]
}
},
{
"node_bindings": {
"n00": [
{
"id": "NCBIGene:1017"
}
],
"n01": [
{
"id": "GO:0007099"
}
]
},
"edge_bindings": {
"e00": [
{
"id": "NCBIGene:1017-GO:0007099-MyGene.info API-entrez"
}
]
}
},
{
"node_bindings": {
"n00": [
{
"id": "NCBIGene:1017"
}
],
"n01": [
{
"id": "GO:0007165"
}
]
},
"edge_bindings": {
"e00": [
{
"id": "NCBIGene:1017-GO:0007165-MyGene.info API-entrez"
}
]
}
},
{
"node_bindings": {
"n00": [
{
"id": "NCBIGene:1017"
}
],
"n01": [
{
"id": "GO:0007265"
}
]
},
"edge_bindings": {
"e00": [
{
"id": "NCBIGene:1017-GO:0007265-MyGene.info API-entrez"
}
]
}
},
{
"node_bindings": {
"n00": [
{
"id": "NCBIGene:1017"
}
],
"n01": [
{
"id": "GO:0008284"
}
]
},
"edge_bindings": {
"e00": [
{
"id": "NCBIGene:1017-GO:0008284-MyGene.info API-entrez"
}
]
}
},
{
"node_bindings": {
"n00": [
{
"id": "NCBIGene:1017"
}
],
"n01": [
{
"id": "GO:0008284"
}
]
},
"edge_bindings": {
"e00": [
{
"id": "NCBIGene:1017-GO:0008284-MyGene.info API-entrez"
}
]
}
},
{
"node_bindings": {
"n00": [
{
"id": "NCBIGene:1017"
}
],
"n01": [
{
"id": "GO:0010389"
}
]
},
"edge_bindings": {
"e00": [
{
"id": "NCBIGene:1017-GO:0010389-MyGene.info API-entrez"
}
]
}
},
{
"node_bindings": {
"n00": [
{
"id": "NCBIGene:1017"
}
],
"n01": [
{
"id": "GO:0010468"
}
]
},
"edge_bindings": {
"e00": [
{
"id": "NCBIGene:1017-GO:0010468-MyGene.info API-entrez"
}
]
}
},
{
"node_bindings": {
"n00": [
{
"id": "NCBIGene:1017"
}
],
"n01": [
{
"id": "GO:0016572"
}
]
},
"edge_bindings": {
"e00": [
{
"id": "NCBIGene:1017-GO:0016572-MyGene.info API-entrez"
}
]
}
},
{
"node_bindings": {
"n00": [
{
"id": "NCBIGene:1017"
}
],
"n01": [
{
"id": "GO:0018105"
}
]
},
"edge_bindings": {
"e00": [
{
"id": "NCBIGene:1017-GO:0018105-MyGene.info API-entrez"
}
]
}
},
{
"node_bindings": {
"n00": [
{
"id": "NCBIGene:1017"
}
],
"n01": [
{
"id": "GO:0031145"
}
]
},
"edge_bindings": {
"e00": [
{
"id": "NCBIGene:1017-GO:0031145-MyGene.info API-entrez"
}
]
}
},
{
"node_bindings": {
"n00": [
{
"id": "NCBIGene:1017"
}
],
"n01": [
{
"id": "GO:0031571"
}
]
},
"edge_bindings": {
"e00": [
{
"id": "NCBIGene:1017-GO:0031571-MyGene.info API-entrez"
}
]
}
},
{
"node_bindings": {
"n00": [
{
"id": "NCBIGene:1017"
}
],
"n01": [
{
"id": "GO:0051298"
}
]
},
"edge_bindings": {
"e00": [
{
"id": "NCBIGene:1017-GO:0051298-MyGene.info API-entrez"
}
]
}
},
{
"node_bindings": {
"n00": [
{
"id": "NCBIGene:1017"
}
],
"n01": [
{
"id": "GO:0051301"
}
]
},
"edge_bindings": {
"e00": [
{
"id": "NCBIGene:1017-GO:0051301-MyGene.info API-entrez"
}
]
}
},
{
"node_bindings": {
"n00": [
{
"id": "NCBIGene:1017"
}
],
"n01": [
{
"id": "GO:0051321"
}
]
},
"edge_bindings": {
"e00": [
{
"id": "NCBIGene:1017-GO:0051321-MyGene.info API-entrez"
}
]
}
},
{
"node_bindings": {
"n00": [
{
"id": "NCBIGene:1017"
}
],
"n01": [
{
"id": "GO:0060968"
}
]
},
"edge_bindings": {
"e00": [
{
"id": "NCBIGene:1017-GO:0060968-MyGene.info API-entrez"
}
]
}
},
{
"node_bindings": {
"n00": [
{
"id": "NCBIGene:1017"
}
],
"n01": [
{
"id": "GO:0071732"
}
]
},
"edge_bindings": {
"e00": [
{
"id": "NCBIGene:1017-GO:0071732-MyGene.info API-entrez"
}
]
}
},
{
"node_bindings": {
"n00": [
{
"id": "NCBIGene:1017"
}
],
"n01": [
{
"id": "GO:1901796"
}
]
},
"edge_bindings": {
"e00": [
{
"id": "NCBIGene:1017-GO:1901796-MyGene.info API-entrez"
}
]
}
}
]
},
"logs": [
{
"timestamp": "2021-03-15T22:48:10.757Z",
"level": "DEBUG",
"message": "BTE identified 2 QNodes from your query graph",
"code": null
},
{
"timestamp": "2021-03-15T22:48:10.757Z",
"level": "DEBUG",
"message": "BTE identified 1 QEdges from your query graph",
"code": null
},
{
"timestamp": "2021-03-15T22:48:10.757Z",
"level": "DEBUG",
"message": "BTE identified your query graph as a 1-depth query graph",
"code": null
},
{
"timestamp": "2021-03-15T22:48:10.757Z",
"level": "DEBUG",
"message": "REDIS cache is not enabled.",
"code": null
},
{
"timestamp": "2021-03-15T22:48:10.797Z",
"level": "DEBUG",
"message": "BTE found 1 smartapi edges corresponding to e00. These smartaip edges comes from 1 unique APIs. They are MyGene.info API",
"code": null
},
{
"timestamp": "2021-03-15T22:48:10.808Z",
"level": "DEBUG",
"message": "BTE found 1 bte edges for this batch.",
"code": null
},
{
"timestamp": "2021-03-15T22:48:10.808Z",
"level": "DEBUG",
"message": "call-apis: Resolving ID feature is turned on",
"code": null
},
{
"timestamp": "2021-03-15T22:48:10.808Z",
"level": "DEBUG",
"message": "call-apis: Number of BTE Edges received is 1",
"code": null
},
{
"timestamp": "2021-03-15T22:48:10.828Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://mygene.info/v3/query\",\"params\":{\"fields\":\"go.BP\"},\"data\":\"q=1017&scopes=entrezgene\",\"method\":\"post\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:48:10.839Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 27 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:48:10.839Z",
"level": "DEBUG",
"message": "call-apis: Total number of results returned for this query is 27",
"code": null
},
{
"timestamp": "2021-03-15T22:48:10.857Z",
"level": "DEBUG",
"message": "call-apis: Query completes",
"code": null
}
]
}
Making a multi hop query
const handler = require("@biothings-explorer/query_graph_handler");
const queryHandler = new handler.TRAPIQueryHandler();
const multiHopQuery = {
"workflow": [
{"id": "lookup"}
],
"message": {
"query_graph": {
"nodes": {
"n0": {
"categories": ["biolink:Disease"],
"ids": ["MONDO:0005737"]
},
"n1": {
"categories": ["biolink:Gene"]
},
"n2": {
"categories": ["biolink:SmallMolecule"]
}
},
"edges": {
"e01": {
"subject": "n0",
"object": "n1"
},
"e02": {
"subject": "n1",
"object": "n2"
}
}
}
}
}
queryHandler.setQueryGraph(multiHopQuery);
await queryHandler.query();
console.log(queryHandler.getResponse())
Example Result
{
"workflow": [
{"id": "lookup"}
],
"message": {
"query_graph": {
"nodes": {
"n0": {
"category": "biolink:Disease",
"id": "MONDO:0005737"
},
"n1": {
"category": "biolink:Gene"
},
"n2": {
"category": "biolink:ChemicalSubstance"
}
},
"edges": {
"e01": {
"subject": "n0",
"object": "n1"
},
"e02": {
"subject": "n1",
"object": "n2"
}
}
},
"knowledge_graph": {
"nodes": {
"MONDO:0005737": {
"category": "biolink:Disease",
"name": "Ebola hemorrhagic fever",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"MONDO:0005737",
"DOID:4325",
"UMLS:C0282687",
"name:Ebola hemorrhagic fever",
"MESH:D019142",
"EFO:0007243",
"ORPHANET:319218",
"GARD:2035"
],
"type": "biolink:id"
}
]
},
"NCBIGene:116534309": {
"category": "biolink:Gene",
"name": "CD4",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:116534309",
"name:CD4 molecule",
"SYMBOL:CD4"
],
"type": "biolink:id"
}
]
},
"NCBIGene:539109": {
"category": "biolink:Gene",
"name": "MMP11",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:539109",
"name:matrix metallopeptidase 11",
"SYMBOL:MMP11",
"ENSEMBL:ENSBTAG00000006108"
],
"type": "biolink:id"
}
]
},
"NCBIGene:102448557": {
"category": "biolink:Gene",
"name": "GTPBP1",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:102448557",
"name:GTP binding protein 1",
"SYMBOL:GTPBP1",
"ENSEMBL:ENSPSIG00000004300"
],
"type": "biolink:id"
}
]
},
"NCBIGene:103074707": {
"category": "biolink:Gene",
"name": "CCL2",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:103074707",
"name:C-C motif chemokine ligand 2",
"SYMBOL:CCL2"
],
"type": "biolink:id"
}
]
},
"ENSEMBL:ENSSPUG00000015633": {
"category": "biolink:Gene",
"name": "MAPRE3",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"name:microtubule associated protein RP/EB family member 3",
"SYMBOL:MAPRE3",
"ENSEMBL:ENSSPUG00000015633"
],
"type": "biolink:id"
}
]
},
"NCBIGene:115865406": {
"category": "biolink:Gene",
"name": "BST2",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:115865406",
"name:bone marrow stromal cell antigen 2",
"SYMBOL:BST2"
],
"type": "biolink:id"
}
]
},
"NCBIGene:110132571": {
"category": "biolink:Gene",
"name": "IL1B",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:110132571",
"name:interleukin 1 beta",
"SYMBOL:IL1B"
],
"type": "biolink:id"
}
]
},
"NCBIGene:101571570": {
"category": "biolink:Gene",
"name": "Ifih1",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:101571570",
"name:interferon induced with helicase C domain 1",
"SYMBOL:Ifih1",
"ENSEMBL:ENSODEG00000013586"
],
"type": "biolink:id"
}
]
},
"ENSEMBL:ENSSMAG00000017984": {
"category": "biolink:Gene",
"name": "npc1",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"name:Niemann-Pick disease, type C1",
"SYMBOL:npc1",
"ENSEMBL:ENSSMAG00000017984"
],
"type": "biolink:id"
}
]
},
"NCBIGene:397686": {
"category": "biolink:Gene",
"name": "IFNA1",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:397686",
"name:interferon, alpha 1",
"SYMBOL:IFNA1",
"ENSEMBL:ENSSSCG00000050619"
],
"type": "biolink:id"
}
]
},
"NCBIGene:102892030": {
"category": "biolink:Gene",
"name": "ALB",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:102892030",
"name:albumin",
"SYMBOL:ALB"
],
"type": "biolink:id"
}
]
},
"NCBIGene:104045425": {
"category": "biolink:Gene",
"name": "HDX",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:104045425",
"name:highly divergent homeobox",
"SYMBOL:HDX"
],
"type": "biolink:id"
}
]
},
"NCBIGene:110137949": {
"category": "biolink:Gene",
"name": "CXCL10",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:110137949",
"name:C-X-C motif chemokine ligand 10",
"SYMBOL:CXCL10"
],
"type": "biolink:id"
}
]
},
"NCBIGene:105822820": {
"category": "biolink:Gene",
"name": "CXCL8",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:105822820",
"name:C-X-C motif chemokine ligand 8",
"SYMBOL:CXCL8",
"ENSEMBL:ENSPCOG00000024593"
],
"type": "biolink:id"
}
]
},
"NCBIGene:116479423": {
"category": "biolink:Gene",
"name": "CLEC4M",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:116479423",
"name:C-type lectin domain family 4 member M",
"SYMBOL:CLEC4M"
],
"type": "biolink:id"
}
]
},
"NCBIGene:103814882": {
"category": "biolink:Gene",
"name": "F3",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:103814882",
"name:coagulation factor III, tissue factor",
"SYMBOL:F3",
"ENSEMBL:ENSSCAG00000012591"
],
"type": "biolink:id"
}
]
},
"NCBIGene:101142722": {
"category": "biolink:Gene",
"name": "KPNA1",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:101142722",
"name:karyopherin subunit alpha 1",
"SYMBOL:KPNA1"
],
"type": "biolink:id"
}
]
},
"NCBIGene:104673720": {
"category": "biolink:Gene",
"name": "CTSL",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:104673720",
"name:cathepsin L",
"SYMBOL:CTSL",
"ENSEMBL:ENSRROG00000038398"
],
"type": "biolink:id"
}
]
},
"NCBIGene:116543050": {
"category": "biolink:Gene",
"name": "CTSB",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:116543050",
"name:cathepsin B",
"SYMBOL:CTSB"
],
"type": "biolink:id"
}
]
},
"NCBIGene:29798": {
"category": "biolink:Gene",
"name": "C2orf27A",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:29798",
"name:chromosome 2 open reading frame 27A",
"SYMBOL:C2orf27A",
"UMLS:C2681192",
"HGNC:25077",
"UniProtKB:P0DPF5"
],
"type": "biolink:id"
}
]
},
"NCBIGene:118012204": {
"category": "biolink:Gene",
"name": "STAT1",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:118012204",
"name:signal transducer and activator of transcription 1",
"SYMBOL:STAT1"
],
"type": "biolink:id"
}
]
},
"NCBIGene:103531663": {
"category": "biolink:Gene",
"name": "KPNA5",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:103531663",
"name:karyopherin subunit alpha 5",
"SYMBOL:KPNA5"
],
"type": "biolink:id"
}
]
},
"ENSEMBL:ENSNVIG00000024389": {
"category": "biolink:Gene",
"name": "IFIT2",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"name:interferon induced protein with tetratricopeptide repeats 2",
"SYMBOL:IFIT2",
"ENSEMBL:ENSNVIG00000024389"
],
"type": "biolink:id"
}
]
},
"NCBIGene:104395366": {
"category": "biolink:Gene",
"name": "THBD",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:104395366",
"name:thrombomodulin",
"SYMBOL:THBD"
],
"type": "biolink:id"
}
]
},
"NCBIGene:100731608": {
"category": "biolink:Gene",
"name": "Isg15",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:100731608",
"name:ISG15 ubiquitin like modifier",
"SYMBOL:Isg15"
],
"type": "biolink:id"
}
]
},
"NCBIGene:108529797": {
"category": "biolink:Gene",
"name": "DDX58",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:108529797",
"name:DExD/H-box helicase 58",
"SYMBOL:DDX58",
"ENSEMBL:ENSRBIG00000040257"
],
"type": "biolink:id"
}
]
},
"NCBIGene:106971145": {
"category": "biolink:Gene",
"name": "IFNB1",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:106971145",
"name:interferon beta 1",
"SYMBOL:IFNB1"
],
"type": "biolink:id"
}
]
},
"SYMBOL:GP2": {
"category": "biolink:Gene",
"name": "GP2",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"name:Polygalacturonase non-catalytic subunit AroGP2",
"SYMBOL:GP2"
],
"type": "biolink:id"
}
]
},
"NCBIGene:101443464": {
"category": "biolink:Gene",
"name": "GPT",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:101443464",
"name:glutamic--pyruvic transaminase",
"SYMBOL:GPT"
],
"type": "biolink:id"
}
]
},
"NCBIGene:102387082": {
"category": "biolink:Gene",
"name": "IRF7",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:102387082",
"name:interferon regulatory factor 7",
"SYMBOL:IRF7"
],
"type": "biolink:id"
}
]
},
"NCBIGene:109055884": {
"category": "biolink:Gene",
"name": "il6",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:109055884",
"name:interleukin 6 (interferon, beta 2)",
"SYMBOL:il6",
"ENSEMBL:ENSCCRG00000034667"
],
"type": "biolink:id"
}
]
},
"ENSEMBL:ENSSBOG00000011322": {
"category": "biolink:Gene",
"name": "CD8A",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"name:CD8a molecule",
"SYMBOL:CD8A",
"ENSEMBL:ENSSBOG00000011322"
],
"type": "biolink:id"
}
]
},
"NCBIGene:117759282": {
"category": "biolink:Gene",
"name": "ace2",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:117759282",
"name:angiotensin I converting enzyme 2",
"SYMBOL:ace2"
],
"type": "biolink:id"
}
]
},
"NCBIGene:103562469": {
"category": "biolink:Gene",
"name": "TNF",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:103562469",
"name:tumor necrosis factor",
"SYMBOL:TNF"
],
"type": "biolink:id"
}
]
},
"NCBIGene:112648300": {
"category": "biolink:Gene",
"name": "IL10",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:112648300",
"name:interleukin 10",
"SYMBOL:IL10",
"ENSEMBL:ENSCAFG00020012434"
],
"type": "biolink:id"
}
]
},
"NCBIGene:105221759": {
"category": "biolink:Gene",
"name": "ERVW-1",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:105221759",
"name:endogenous retrovirus group W member 1, envelope",
"SYMBOL:ERVW-1"
],
"type": "biolink:id"
}
]
},
"NCBIGene:118335909": {
"category": "biolink:Gene",
"name": "irf3",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:118335909",
"name:interferon regulatory factor 3",
"SYMBOL:irf3"
],
"type": "biolink:id"
}
]
},
"NCBIGene:101674197": {
"category": "biolink:Gene",
"name": "CCL5",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:101674197",
"name:C-C motif chemokine ligand 5",
"SYMBOL:CCL5"
],
"type": "biolink:id"
}
]
},
"NCBIGene:103089296": {
"category": "biolink:Gene",
"name": "CCL3",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:103089296",
"name:C-C motif chemokine ligand 3",
"SYMBOL:CCL3"
],
"type": "biolink:id"
}
]
},
"NCBIGene:100136221": {
"category": "biolink:Gene",
"name": "ccl4",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:100136221",
"name:CCL4 protein",
"SYMBOL:ccl4",
"ENSEMBL:ENSOMYG00000026069"
],
"type": "biolink:id"
}
]
},
"NCBIGene:118023076": {
"category": "biolink:Gene",
"name": "FURIN",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:118023076",
"name:furin, paired basic amino acid cleaving enzyme",
"SYMBOL:FURIN"
],
"type": "biolink:id"
}
]
},
"NCBIGene:574217": {
"category": "biolink:Gene",
"name": "CCL4L1",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:574217",
"name:chemokine (C-C motif) ligand 4-like 1",
"SYMBOL:CCL4L1",
"UniProtKB:Q8HYQ2",
"ENSEMBL:ENSMMUG00000020102"
],
"type": "biolink:id"
}
]
},
"UMLS:C1707151": {
"category": "biolink:Gene",
"name": "UMLS:C1707151",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C1707151"
],
"type": "biolink:id"
}
]
},
"UMLS:C1707163": {
"category": "biolink:Gene",
"name": "UMLS:C1707163",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C1707163"
],
"type": "biolink:id"
}
]
},
"NCBIGene:3601": {
"category": "biolink:Gene",
"name": "IL15RA",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:3601",
"name:interleukin 15 receptor subunit alpha",
"SYMBOL:IL15RA",
"UMLS:C1416387",
"HGNC:5978",
"UniProtKB:Q13261",
"ENSEMBL:ENSG00000134470",
"OMIM:601070"
],
"type": "biolink:id"
}
]
},
"NCBIGene:5788": {
"category": "biolink:Gene",
"name": "PTPRC",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:5788",
"name:protein tyrosine phosphatase receptor type C",
"SYMBOL:PTPRC",
"UMLS:C1335285",
"HGNC:9666",
"UniProtKB:P08575",
"ENSEMBL:ENSG00000081237",
"ENSEMBL:ENSG00000262418",
"OMIM:151460"
],
"type": "biolink:id"
}
]
},
"NCBIGene:8030": {
"category": "biolink:Gene",
"name": "CCDC6",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:8030",
"name:coiled-coil domain containing 6",
"SYMBOL:CCDC6",
"UMLS:C1425774",
"HGNC:18782",
"UniProtKB:Q16204",
"ENSEMBL:ENSG00000108091",
"OMIM:601985"
],
"type": "biolink:id"
}
]
},
"NCBIGene:920": {
"category": "biolink:Gene",
"name": "CD4",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:920",
"name:CD4 molecule",
"SYMBOL:CD4",
"UMLS:C1332714",
"HGNC:1678",
"UniProtKB:P01730",
"ENSEMBL:ENSG00000010610",
"OMIM:186940"
],
"type": "biolink:id"
}
]
},
"NCBIGene:1514": {
"category": "biolink:Gene",
"name": "CTSL",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:1514",
"name:cathepsin L",
"SYMBOL:CTSL",
"UMLS:C1332807",
"UMLS:C0054871",
"HGNC:2537",
"UniProtKB:P07711",
"ENSEMBL:ENSG00000135047",
"OMIM:116880"
],
"type": "biolink:id"
}
]
},
"UMLS:C1706438": {
"category": "biolink:Gene",
"name": "UMLS:C1706438",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C1706438"
],
"type": "biolink:id"
}
]
},
"UMLS:C1367471": {
"category": "biolink:Gene",
"name": "UMLS:C1367471",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C1367471"
],
"type": "biolink:id"
}
]
},
"NCBIGene:3439": {
"category": "biolink:Gene",
"name": "IFNA1",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:3439",
"name:interferon alpha 1",
"SYMBOL:IFNA1",
"UMLS:C1415900",
"HGNC:5417",
"UniProtKB:P01562",
"ENSEMBL:ENSG00000197919",
"OMIM:147660"
],
"type": "biolink:id"
}
]
},
"UMLS:C1708411": {
"category": "biolink:Gene",
"name": "UMLS:C1708411",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C1708411"
],
"type": "biolink:id"
}
]
},
"UMLS:C0017337": {
"category": "biolink:Gene",
"name": "UMLS:C0017337",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C0017337"
],
"type": "biolink:id"
}
]
},
"UMLS:C1335439": {
"category": "biolink:Gene",
"name": "UMLS:C1335439",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C1335439"
],
"type": "biolink:id"
}
]
},
"NCBIGene:3557": {
"category": "biolink:Gene",
"name": "IL1RN",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:3557",
"name:interleukin 1 receptor antagonist",
"SYMBOL:IL1RN",
"UMLS:C1416402",
"HGNC:6000",
"UniProtKB:P18510",
"ENSEMBL:ENSG00000136689",
"OMIM:147679"
],
"type": "biolink:id"
}
]
},
"UMLS:C1705770": {
"category": "biolink:Gene",
"name": "UMLS:C1705770",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C1705770"
],
"type": "biolink:id"
}
]
},
"NCBIGene:1520": {
"category": "biolink:Gene",
"name": "CTSS",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:1520",
"name:cathepsin S",
"SYMBOL:CTSS",
"UMLS:C1413821",
"HGNC:2545",
"UniProtKB:P25774",
"ENSEMBL:ENSG00000163131",
"OMIM:116845"
],
"type": "biolink:id"
}
]
},
"NCBIGene:3806": {
"category": "biolink:Gene",
"name": "KIR2DS1",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:3806",
"name:killer cell immunoglobulin like receptor, two Ig domains and short cytoplasmic tail 1",
"SYMBOL:KIR2DS1",
"UMLS:C1416647",
"HGNC:6333",
"UniProtKB:Q14954",
"ENSEMBL:ENSG00000278120",
"ENSEMBL:ENSG00000283937",
"ENSEMBL:ENSG00000284120",
"ENSEMBL:ENSG00000284150",
"ENSEMBL:ENSG00000275921",
"ENSEMBL:ENSG00000276327",
"OMIM:604952"
],
"type": "biolink:id"
}
]
},
"NCBIGene:3808": {
"category": "biolink:Gene",
"name": "KIR2DS3",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:3808",
"name:killer cell immunoglobulin like receptor, two Ig domains and short cytoplasmic tail 3",
"SYMBOL:KIR2DS3",
"UMLS:C1416649",
"HGNC:6335",
"UniProtKB:Q14952",
"ENSEMBL:ENSG00000278306",
"ENSEMBL:ENSG00000274739",
"ENSEMBL:ENSG00000284039",
"OMIM:604954"
],
"type": "biolink:id"
}
]
},
"UMLS:C1705846": {
"category": "biolink:Gene",
"name": "UMLS:C1705846",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C1705846"
],
"type": "biolink:id"
}
]
},
"NCBIGene:558": {
"category": "biolink:Gene",
"name": "AXL",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:558",
"name:AXL receptor tyrosine kinase",
"SYMBOL:AXL",
"UMLS:C0812237",
"HGNC:905",
"UniProtKB:P30530",
"ENSEMBL:ENSG00000167601",
"OMIM:109135"
],
"type": "biolink:id"
}
]
},
"UMLS:C1705742": {
"category": "biolink:Gene",
"name": "UMLS:C1705742",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C1705742"
],
"type": "biolink:id"
}
]
},
"UMLS:C0007428": {
"category": "biolink:Gene",
"name": "UMLS:C0007428",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C0007428"
],
"type": "biolink:id"
}
]
},
"UMLS:C0017428": {
"category": "biolink:Gene",
"name": "UMLS:C0017428",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C0017428"
],
"type": "biolink:id"
}
]
},
"UMLS:C0031727": {
"category": "biolink:Gene",
"name": "UMLS:C0031727",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C0031727"
],
"type": "biolink:id"
}
]
},
"UMLS:C0298973": {
"category": "biolink:Gene",
"name": "UMLS:C0298973",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C0298973"
],
"type": "biolink:id"
}
]
},
"UMLS:C0389995": {
"category": "biolink:Gene",
"name": "UMLS:C0389995",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C0389995"
],
"type": "biolink:id"
}
]
},
"UMLS:C0699919": {
"category": "biolink:Gene",
"name": "UMLS:C0699919",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C0699919"
],
"type": "biolink:id"
}
]
},
"UMLS:C1136352": {
"category": "biolink:Gene",
"name": "UMLS:C1136352",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C1136352"
],
"type": "biolink:id"
}
]
},
"UMLS:C1704867": {
"category": "biolink:Gene",
"name": "UMLS:C1704867",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C1704867"
],
"type": "biolink:id"
}
]
},
"UMLS:C1705766": {
"category": "biolink:Gene",
"name": "UMLS:C1705766",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C1705766"
],
"type": "biolink:id"
}
]
},
"NCBIGene:4864": {
"category": "biolink:Gene",
"name": "NPC1",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:4864",
"name:NPC intracellular cholesterol transporter 1",
"SYMBOL:NPC1",
"UMLS:C1417776",
"HGNC:7897",
"UniProtKB:O15118",
"ENSEMBL:ENSG00000141458",
"OMIM:607623"
],
"type": "biolink:id"
}
]
},
"UMLS:C1704661": {
"category": "biolink:Gene",
"name": "UMLS:C1704661",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C1704661"
],
"type": "biolink:id"
}
]
},
"UMLS:C1704799": {
"category": "biolink:Gene",
"name": "UMLS:C1704799",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C1704799"
],
"type": "biolink:id"
}
]
},
"UMLS:C2985367": {
"category": "biolink:Gene",
"name": "UMLS:C2985367",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C2985367"
],
"type": "biolink:id"
}
]
},
"UMLS:C1705581": {
"category": "biolink:Gene",
"name": "UMLS:C1705581",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C1705581"
],
"type": "biolink:id"
}
]
},
"UMLS:C0044602": {
"category": "biolink:Gene",
"name": "UMLS:C0044602",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C0044602"
],
"type": "biolink:id"
}
]
},
"NCBIGene:324": {
"category": "biolink:Gene",
"name": "APC",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:324",
"name:APC regulator of WNT signaling pathway",
"SYMBOL:APC",
"UMLS:C0162832",
"HGNC:583",
"UniProtKB:P25054",
"ENSEMBL:ENSG00000134982",
"OMIM:611731"
],
"type": "biolink:id"
}
]
},
"UMLS:C0287990": {
"category": "biolink:Gene",
"name": "UMLS:C0287990",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C0287990"
],
"type": "biolink:id"
}
]
},
"UMLS:C0752243": {
"category": "biolink:Gene",
"name": "UMLS:C0752243",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C0752243"
],
"type": "biolink:id"
}
]
},
"DRUGBANK:DB06241": {
"category": "biolink:ChemicalSubstance",
"name": "Clenoliximab",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"DRUGBANK:DB06241",
"UMLS:C0909596",
"MESH:C121870",
"name:Clenoliximab",
"name:clenoliximab"
],
"type": "biolink:id"
}
]
},
"DRUGBANK:DB12698": {
"category": "biolink:ChemicalSubstance",
"name": "Ibalizumab",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"DRUGBANK:DB12698",
"name:Ibalizumab"
],
"type": "biolink:id"
}
]
},
"DRUGBANK:DB00098": {
"category": "biolink:ChemicalSubstance",
"name": "Antithymocyte immunoglobulin (rabbit)",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"DRUGBANK:DB00098",
"UMLS:C0021027",
"MESH:D007136",
"name:Antithymocyte immunoglobulin (rabbit)",
"name:Immunoglobulin",
"name:antithymocyte globulin"
],
"type": "biolink:id"
}
]
}
},
"edges": {
"MONDO:0005737-NCBIGene:116534309-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:116534309",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:539109-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:539109",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:102448557-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:102448557",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:103074707-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:103074707",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-ENSEMBL:ENSSPUG00000015633-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "ENSEMBL:ENSSPUG00000015633",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:115865406-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:115865406",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:110132571-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:110132571",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:101571570-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:101571570",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-ENSEMBL:ENSSMAG00000017984-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "ENSEMBL:ENSSMAG00000017984",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:397686-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:397686",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:102892030-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:102892030",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:104045425-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:104045425",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:110137949-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:110137949",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:105822820-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:105822820",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:116479423-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:116479423",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:103814882-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:103814882",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:101142722-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:101142722",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:104673720-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:104673720",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:116543050-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:116543050",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:29798-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:29798",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:118012204-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:118012204",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:103531663-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:103531663",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-ENSEMBL:ENSNVIG00000024389-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "ENSEMBL:ENSNVIG00000024389",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:104395366-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:104395366",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:100731608-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:100731608",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:108529797-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:108529797",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:106971145-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:106971145",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-SYMBOL:GP2-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "SYMBOL:GP2",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:101443464-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:101443464",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:102387082-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:102387082",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:109055884-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:109055884",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-ENSEMBL:ENSSBOG00000011322-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "ENSEMBL:ENSSBOG00000011322",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:117759282-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:117759282",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:103562469-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:103562469",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:112648300-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:112648300",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:105221759-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:105221759",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:118335909-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:118335909",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:101674197-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:101674197",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:103089296-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:103089296",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:100136221-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:100136221",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:118023076-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:118023076",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-NCBIGene:574217-DISEASES API-DISEASES": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:574217",
"attributes": [
{
"name": "provided_by",
"value": "DISEASES",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "DISEASES API",
"type": "bts:api"
},
{
"name": "category",
"value": "textmining",
"type": "bts:category"
}
]
},
"MONDO:0005737-UMLS:C1707151-SEMMED Disease API-SEMMED": {
"predicate": "biolink:affected_by",
"subject": "MONDO:0005737",
"object": "UMLS:C1707151",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:27595844"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-UMLS:C1707163-SEMMED Disease API-SEMMED": {
"predicate": "biolink:affected_by",
"subject": "MONDO:0005737",
"object": "UMLS:C1707163",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:20466822"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-NCBIGene:3601-SEMMED Disease API-SEMMED": {
"predicate": "biolink:affected_by",
"subject": "MONDO:0005737",
"object": "NCBIGene:3601",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:27595844"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-NCBIGene:5788-SEMMED Disease API-SEMMED": {
"predicate": "biolink:affected_by",
"subject": "MONDO:0005737",
"object": "NCBIGene:5788",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:19683682"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-NCBIGene:8030-SEMMED Disease API-SEMMED": {
"predicate": "biolink:affected_by",
"subject": "MONDO:0005737",
"object": "NCBIGene:8030",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:25722412"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-NCBIGene:920-SEMMED Disease API-SEMMED": {
"predicate": "biolink:affected_by",
"subject": "MONDO:0005737",
"object": "NCBIGene:920",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:16002721"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-NCBIGene:1514-SEMMED Disease API-SEMMED": {
"predicate": "biolink:affected_by",
"subject": "MONDO:0005737",
"object": "NCBIGene:1514",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:20466822"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-UMLS:C1706438-SEMMED Disease API-SEMMED": {
"predicate": "biolink:caused_by",
"subject": "MONDO:0005737",
"object": "UMLS:C1706438",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:21857654"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-UMLS:C1367471-SEMMED Disease API-SEMMED": {
"predicate": "biolink:caused_by",
"subject": "MONDO:0005737",
"object": "UMLS:C1367471",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:21857654"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-NCBIGene:3439-SEMMED Disease API-SEMMED": {
"predicate": "biolink:disrupted_by",
"subject": "MONDO:0005737",
"object": "NCBIGene:3439",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:22958256"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-UMLS:C1708411-SEMMED Disease API-SEMMED": {
"predicate": "biolink:disrupted_by",
"subject": "MONDO:0005737",
"object": "UMLS:C1708411",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:26562011"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-UMLS:C0017337-SEMMED Disease API-SEMMED": {
"predicate": "biolink:disrupted_by",
"subject": "MONDO:0005737",
"object": "UMLS:C0017337",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:26562011"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-UMLS:C1335439-SEMMED Disease API-SEMMED": {
"predicate": "biolink:disrupted_by",
"subject": "MONDO:0005737",
"object": "UMLS:C1335439",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:26397100"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-NCBIGene:3557-SEMMED Disease API-SEMMED": {
"predicate": "biolink:prevented_by",
"subject": "MONDO:0005737",
"object": "NCBIGene:3557",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:26209680"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-UMLS:C1705770-SEMMED Disease API-SEMMED": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "UMLS:C1705770",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:16571833"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-NCBIGene:1520-SEMMED Disease API-SEMMED": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:1520",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:19775255"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-NCBIGene:3806-SEMMED Disease API-SEMMED": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:3806",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:20878400"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-NCBIGene:3808-SEMMED Disease API-SEMMED": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:3808",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:20878400"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-UMLS:C1705846-SEMMED Disease API-SEMMED": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "UMLS:C1705846",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:27659453"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-NCBIGene:558-SEMMED Disease API-SEMMED": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "NCBIGene:558",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:17940958"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-UMLS:C1705742-SEMMED Disease API-SEMMED": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "UMLS:C1705742",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:26376249"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-UMLS:C0007428-SEMMED Disease API-SEMMED": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "UMLS:C0007428",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:19775255"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-UMLS:C0017428-SEMMED Disease API-SEMMED": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "UMLS:C0017428",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:26051281"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-UMLS:C0031727-SEMMED Disease API-SEMMED": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "UMLS:C0031727",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:27659453"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-UMLS:C0298973-SEMMED Disease API-SEMMED": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "UMLS:C0298973",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:27659453"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-UMLS:C0389995-SEMMED Disease API-SEMMED": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "UMLS:C0389995",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:25512227"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-UMLS:C0699919-SEMMED Disease API-SEMMED": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "UMLS:C0699919",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:16571833"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-UMLS:C1136352-SEMMED Disease API-SEMMED": {
"predicate": "biolink:related_to",
"subject": "MONDO:0005737",
"object": "UMLS:C1136352",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:11752702"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-UMLS:C1704867-SEMMED Disease API-SEMMED": {
"predicate": "biolink:treated_by",
"subject": "MONDO:0005737",
"object": "UMLS:C1704867",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:14645601"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-UMLS:C1705766-SEMMED Disease API-SEMMED": {
"predicate": "biolink:treated_by",
"subject": "MONDO:0005737",
"object": "UMLS:C1705766",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:28659436"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-NCBIGene:4864-SEMMED Disease API-SEMMED": {
"predicate": "biolink:treated_by",
"subject": "MONDO:0005737",
"object": "NCBIGene:4864",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:26698106"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-UMLS:C1704661-SEMMED Disease API-SEMMED": {
"predicate": "biolink:treated_by",
"subject": "MONDO:0005737",
"object": "UMLS:C1704661",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:25347780"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-UMLS:C1704799-SEMMED Disease API-SEMMED": {
"predicate": "biolink:treated_by",
"subject": "MONDO:0005737",
"object": "UMLS:C1704799",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:26900129"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-UMLS:C2985367-SEMMED Disease API-SEMMED": {
"predicate": "biolink:treated_by",
"subject": "MONDO:0005737",
"object": "UMLS:C2985367",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:17940975"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-UMLS:C1705581-SEMMED Disease API-SEMMED": {
"predicate": "biolink:treated_by",
"subject": "MONDO:0005737",
"object": "UMLS:C1705581",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:26740837"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-UMLS:C0044602-SEMMED Disease API-SEMMED": {
"predicate": "biolink:treated_by",
"subject": "MONDO:0005737",
"object": "UMLS:C0044602",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:28403145"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-NCBIGene:324-SEMMED Disease API-SEMMED": {
"predicate": "biolink:treated_by",
"subject": "MONDO:0005737",
"object": "NCBIGene:324",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:28659436"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-UMLS:C0287990-SEMMED Disease API-SEMMED": {
"predicate": "biolink:treated_by",
"subject": "MONDO:0005737",
"object": "UMLS:C0287990",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:25347780"
],
"type": "biolink:publications"
}
]
},
"MONDO:0005737-UMLS:C0752243-SEMMED Disease API-SEMMED": {
"predicate": "biolink:treated_by",
"subject": "MONDO:0005737",
"object": "UMLS:C0752243",
"attributes": [
{
"name": "provided_by",
"value": "SEMMED",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "SEMMED Disease API",
"type": "bts:api"
},
{
"name": "publications",
"value": [
"PMID:17229700"
],
"type": "biolink:publications"
}
]
},
"NCBIGene:116534309-DRUGBANK:DB06241-MyChem.info API-drugbank": {
"predicate": "biolink:physically_interacts_with",
"subject": "NCBIGene:116534309",
"object": "DRUGBANK:DB06241",
"attributes": [
{
"name": "provided_by",
"value": "drugbank",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "MyChem.info API",
"type": "bts:api"
}
]
},
"NCBIGene:116534309-DRUGBANK:DB12698-MyChem.info API-drugbank": {
"predicate": "biolink:physically_interacts_with",
"subject": "NCBIGene:116534309",
"object": "DRUGBANK:DB12698",
"attributes": [
{
"name": "provided_by",
"value": "drugbank",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "MyChem.info API",
"type": "bts:api"
}
]
},
"NCBIGene:116534309-DRUGBANK:DB00098-MyChem.info API-drugbank": {
"predicate": "biolink:physically_interacts_with",
"subject": "NCBIGene:116534309",
"object": "DRUGBANK:DB00098",
"attributes": [
{
"name": "provided_by",
"value": "drugbank",
"type": "biolink:provided_by"
},
{
"name": "api",
"value": "MyChem.info API",
"type": "bts:api"
}
]
}
}
},
"results": [
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:116534309"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:116534309-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:539109"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:539109-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:102448557"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:102448557-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:103074707"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:103074707-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "ENSEMBL:ENSSPUG00000015633"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-ENSEMBL:ENSSPUG00000015633-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:115865406"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:115865406-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:110132571"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:110132571-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:101571570"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:101571570-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "ENSEMBL:ENSSMAG00000017984"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-ENSEMBL:ENSSMAG00000017984-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:397686"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:397686-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:102892030"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:102892030-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:104045425"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:104045425-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:110137949"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:110137949-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:105822820"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:105822820-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:116479423"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:116479423-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:103814882"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:103814882-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:101142722"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:101142722-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:104673720"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:104673720-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:116543050"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:116543050-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:29798"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:29798-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:118012204"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:118012204-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:103531663"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:103531663-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "ENSEMBL:ENSNVIG00000024389"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-ENSEMBL:ENSNVIG00000024389-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:104395366"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:104395366-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:100731608"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:100731608-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:108529797"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:108529797-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:106971145"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:106971145-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "SYMBOL:GP2"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-SYMBOL:GP2-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:101443464"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:101443464-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:102387082"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:102387082-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:109055884"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:109055884-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "ENSEMBL:ENSSBOG00000011322"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-ENSEMBL:ENSSBOG00000011322-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:117759282"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:117759282-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:103562469"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:103562469-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:112648300"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:112648300-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:105221759"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:105221759-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:118335909"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:118335909-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:101674197"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:101674197-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:103089296"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:103089296-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:100136221"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:100136221-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:118023076"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:118023076-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:574217"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:574217-DISEASES API-DISEASES"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C1707151"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C1707151-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C1707163"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C1707163-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:3601"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:3601-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:5788"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:5788-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:8030"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:8030-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:920"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:920-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:1514"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:1514-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C1706438"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C1706438-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C1367471"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C1367471-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:3439"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:3439-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C1708411"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C1708411-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C0017337"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C0017337-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C1335439"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C1335439-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:3557"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:3557-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C1705770"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C1705770-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C1707163"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C1707163-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:1520"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:1520-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:3439"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:3439-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:3557"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:3557-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:3806"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:3806-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:3808"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:3808-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C1705846"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C1705846-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:558"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:558-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C1705742"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C1705742-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C0007428"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C0007428-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C0017428"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C0017428-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C0031727"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C0031727-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:1514"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:1514-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C0298973"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C0298973-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C0389995"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C0389995-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C0699919"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C0699919-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C1136352"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C1136352-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C1704867"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C1704867-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C1705766"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C1705766-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:4864"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:4864-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C1704661"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C1704661-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C1704799"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C1704799-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C2985367"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C2985367-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C1705581"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C1705581-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C0007428"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C0007428-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C0031727"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C0031727-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C0044602"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C0044602-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "NCBIGene:324"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-NCBIGene:324-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C0287990"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C0287990-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C0389995"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C0389995-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n0": [
{
"id": "MONDO:0005737"
}
],
"n1": [
{
"id": "UMLS:C0752243"
}
]
},
"edge_bindings": {
"e01": [
{
"id": "MONDO:0005737-UMLS:C0752243-SEMMED Disease API-SEMMED"
}
]
}
},
{
"node_bindings": {
"n1": [
{
"id": "NCBIGene:116534309"
}
],
"n2": [
{
"id": "DRUGBANK:DB06241"
}
]
},
"edge_bindings": {
"e02": [
{
"id": "NCBIGene:116534309-DRUGBANK:DB06241-MyChem.info API-drugbank"
}
]
}
},
{
"node_bindings": {
"n1": [
{
"id": "NCBIGene:116534309"
}
],
"n2": [
{
"id": "DRUGBANK:DB12698"
}
]
},
"edge_bindings": {
"e02": [
{
"id": "NCBIGene:116534309-DRUGBANK:DB12698-MyChem.info API-drugbank"
}
]
}
},
{
"node_bindings": {
"n1": [
{
"id": "NCBIGene:116534309"
}
],
"n2": [
{
"id": "DRUGBANK:DB00098"
}
]
},
"edge_bindings": {
"e02": [
{
"id": "NCBIGene:116534309-DRUGBANK:DB00098-MyChem.info API-drugbank"
}
]
}
}
]
},
"logs": [
{
"timestamp": "2021-03-15T22:54:01.080Z",
"level": "DEBUG",
"message": "BTE identified 3 QNodes from your query graph",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.080Z",
"level": "DEBUG",
"message": "BTE identified 2 QEdges from your query graph",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.080Z",
"level": "DEBUG",
"message": "BTE identified your query graph as a 2-depth query graph",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.080Z",
"level": "DEBUG",
"message": "REDIS cache is not enabled.",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.160Z",
"level": "DEBUG",
"message": "BTE found 23 smartapi edges corresponding to e01. These smartaip edges comes from 7 unique APIs. They are MyDisease.info API,MGIgene2phenotype API,DISEASES API,SEMMED Disease API,Text Mining CO-OCCURRENCE API,TCGA Mutation Frequency KP API,BioLink API",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.297Z",
"level": "DEBUG",
"message": "BTE found 23 bte edges for this batch.",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.297Z",
"level": "DEBUG",
"message": "call-apis: Resolving ID feature is turned on",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.297Z",
"level": "DEBUG",
"message": "call-apis: Number of BTE Edges received is 23",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.321Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"http://mydisease.info/v1/query\",\"params\":{\"fields\":\"disgenet.genes_related_to_disease\"},\"data\":\"q=C0282687&scopes=mondo.xrefs.umls, disgenet.xrefs.umls\",\"method\":\"post\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.325Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.388Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/DISEASES/query\",\"params\":{\"fields\":\"DISEASES.associatedWith\"},\"data\":\"q=DOID:4325&scopes=DISEASES.doid\",\"method\":\"post\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.397Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 42 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.398Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/text_mining_co_occurrence_kp/query\",\"params\":{\"fields\":\"subject,association\",\"q\":\"object.MONDO:\\\"MONDO:0005737\\\" AND subject.type:Gene\",\"size\":1000},\"method\":\"get\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.398Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.398Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/mgigene2phenotype/query\",\"params\":{\"fields\":\"_id\",\"size\":\"300\"},\"data\":\"q=DOID:4325&scopes=mgi.associated_with_disease.doid\",\"method\":\"post\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.398Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.399Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/tcga_mut_freq_kp/query\",\"params\":{\"fields\":\"association.freq_by_sample,subject.SYMBOL\",\"q\":\"object.id:\\\"MONDO:0005737\\\" AND association.freq_by_sample:>0.1\",\"size\":\"1000\",\"sort\":\"-association.freq_by_sample\"},\"method\":\"get\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.399Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.399Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"caused_by\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.400Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 2 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.400Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"affected_by\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.400Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 7 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.401Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"affects\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.401Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.439Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/text_mining_co_occurrence_kp/query\",\"params\":{\"fields\":\"object,association\",\"q\":\"subject.MONDO:\\\"MONDO:0005737\\\" AND object.type:Gene\",\"size\":1000},\"method\":\"get\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.628Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.706Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://api.monarchinitiative.org/api/bioentity/disease/MONDO:0005737/genes\",\"params\":{\"direct\":true,\"rows\":200,\"unselect_evidence\":true},\"method\":\"get\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.707Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.709Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://api.monarchinitiative.org/api/bioentity/disease/MONDO:0005737/genes\",\"params\":{\"direct\":true,\"rows\":200,\"unselect_evidence\":true},\"method\":\"get\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.709Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.722Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"derives_from\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.722Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.723Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"disrupted_by\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.723Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 4 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.724Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"coexists_with\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.724Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.736Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"negatively_regulates\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.736Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.737Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"negatively_regulated_by\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.737Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.737Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"disrupts\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.737Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.749Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"physically_interacts_with\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.749Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.750Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"positively_regulates\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.750Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.750Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"positively_regulated_by\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.750Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.762Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"related_to\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.763Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 18 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.763Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"prevented_by\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.763Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 1 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.764Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/semmed/query\",\"params\":{\"fields\":\"treated_by\"},\"data\":\"q=C0282687&scopes=umls\",\"method\":\"post\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.765Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 14 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.765Z",
"level": "DEBUG",
"message": "call-apis: Total number of results returned for this query is 88",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.974Z",
"level": "DEBUG",
"message": "call-apis: Query completes",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.978Z",
"level": "DEBUG",
"message": "REDIS cache is not enabled.",
"code": null
},
{
"timestamp": "2021-03-15T22:54:01.997Z",
"level": "DEBUG",
"message": "BTE found 20 smartapi edges corresponding to e02. These smartaip edges comes from 7 unique APIs. They are OpenTarget API,MyChem.info API,SEMMED Gene API,BioThings DGIdb API,Text Mining Targeted Association API,Text Mining CO-OCCURRENCE API,Drug Response KP API",
"code": null
},
{
"timestamp": "2021-03-15T22:54:02.041Z",
"level": "DEBUG",
"message": "BTE found 7 bte edges for this batch.",
"code": null
},
{
"timestamp": "2021-03-15T22:54:02.041Z",
"level": "DEBUG",
"message": "call-apis: Resolving ID feature is turned on",
"code": null
},
{
"timestamp": "2021-03-15T22:54:02.041Z",
"level": "DEBUG",
"message": "call-apis: Number of BTE Edges received is 7",
"code": null
},
{
"timestamp": "2021-03-15T22:54:02.102Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/text_mining_co_occurrence_kp/query\",\"params\":{\"fields\":\"subject,association\",\"q\":\"object.NCBIGene:\\\"116534309\\\" AND subject.type:ChemicalSubstance\",\"size\":1000},\"method\":\"get\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:02.102Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:02.103Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/text_mining_co_occurrence_kp/query\",\"params\":{\"fields\":\"object,association\",\"q\":\"subject.NCBIGene:\\\"116534309\\\" AND object.type:ChemicalSubstance\",\"size\":1000},\"method\":\"get\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:02.103Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:02.104Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/dgidb/query\",\"params\":{\"fields\":\"object.CHEMBL_COMPOUND,association.provided_by,association.pubmed\",\"size\":1000},\"data\":\"q=116534309&scopes=subject.NCBIGene\",\"method\":\"post\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:02.104Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:02.104Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://biothings.ncats.io/drug_response_kp/query\",\"params\":{\"fields\":\"association.context.disease.mondo,object.PUBCHEM,association.effect_size,association.pvalue\",\"q\":\"subject.NCBIGene:116534309 AND association.effect_size:<0 AND association.pvalue:<0.05\",\"size\":\"1000\",\"sort\":\"association.pvalue\"},\"method\":\"get\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:02.104Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:02.109Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://mychem.info/v1/query\",\"params\":{\"fields\":\"chembl.molecule_chembl_id\",\"size\":\"250\"},\"data\":\"q=CD4&scopes=drugcentral.bioactivity.uniprot.gene_symbol\",\"method\":\"post\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:02.109Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:02.110Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://mychem.info/v1/query\",\"params\":{\"fields\":\"drugbank.id\",\"size\":\"250\"},\"data\":\"q=CD4&scopes=drugbank.targets.gene_name\",\"method\":\"post\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:02.110Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 3 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:02.112Z",
"level": "DEBUG",
"message": "call-apis: Succesfully made the following query: {\"url\":\"https://mychem.info/v1/query\",\"params\":{\"fields\":\"drugbank.id\",\"size\":\"250\"},\"data\":\"q=CD4&scopes=drugbank.enzymes.gene_name\",\"method\":\"post\",\"timeout\":50000}",
"code": null
},
{
"timestamp": "2021-03-15T22:54:02.112Z",
"level": "DEBUG",
"message": "call-apis: After transformation, BTE is able to retrieve 0 hits!",
"code": null
},
{
"timestamp": "2021-03-15T22:54:02.112Z",
"level": "DEBUG",
"message": "call-apis: Total number of results returned for this query is 3",
"code": null
},
{
"timestamp": "2021-03-15T22:54:02.181Z",
"level": "DEBUG",
"message": "call-apis: Query completes",
"code": null
}
]
}
Making a branched query
const handler = require("@biothings-explorer/query_graph_handler");
const queryHandler = new handler.TRAPIQueryHandler();
const branchedQuery = {
"workflow": [
{"id": "lookup"}
],
"message": {
"query_graph": {
"nodes": {
"n0": {
"categories": ["biolink:Disease"],
"ids": ["MONDO:0005737"]
},
"n1": {
"categories": ["biolink:Gene"]
},
"n2": {
"categories": ["biolink:SmallMolecule"]
}
},
"edges": {
"e01": {
"subject": "n0",
"object": "n1"
},
"e02": {
"subject": "n0",
"object": "n2"
}
}
}
}
}
queryHandler.setQueryGraph(branchedQuery);
await queryHandler.query();
console.log(queryHandler.getResponse())
Example Result
{
"workflow": [
{"id": "lookup"}
],
"message": {
"query_graph": {
"nodes": {
"n0": {
"category": "biolink:Disease",
"id": "MONDO:0005737"
},
"n1": {
"category": "biolink:Gene"
},
"n2": {
"category": "biolink:ChemicalSubstance"
}
},
"edges": {
"e01": {
"subject": "n0",
"object": "n1"
},
"e02": {
"subject": "n0",
"object": "n2"
}
}
},
"knowledge_graph": {
"nodes": {
"MONDO:0005737": {
"category": "biolink:Disease",
"name": "Ebola hemorrhagic fever",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"MONDO:0005737",
"DOID:4325",
"UMLS:C0282687",
"name:Ebola hemorrhagic fever",
"MESH:D019142",
"EFO:0007243",
"ORPHANET:319218",
"GARD:2035"
],
"type": "biolink:id"
}
]
},
"NCBIGene:116534309": {
"category": "biolink:Gene",
"name": "CD4",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:116534309",
"name:CD4 molecule",
"SYMBOL:CD4"
],
"type": "biolink:id"
}
]
},
"NCBIGene:539109": {
"category": "biolink:Gene",
"name": "MMP11",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:539109",
"name:matrix metallopeptidase 11",
"SYMBOL:MMP11",
"ENSEMBL:ENSBTAG00000006108"
],
"type": "biolink:id"
}
]
},
"NCBIGene:102448557": {
"category": "biolink:Gene",
"name": "GTPBP1",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:102448557",
"name:GTP binding protein 1",
"SYMBOL:GTPBP1",
"ENSEMBL:ENSPSIG00000004300"
],
"type": "biolink:id"
}
]
},
"NCBIGene:103074707": {
"category": "biolink:Gene",
"name": "CCL2",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:103074707",
"name:C-C motif chemokine ligand 2",
"SYMBOL:CCL2"
],
"type": "biolink:id"
}
]
},
"ENSEMBL:ENSSPUG00000015633": {
"category": "biolink:Gene",
"name": "MAPRE3",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"name:microtubule associated protein RP/EB family member 3",
"SYMBOL:MAPRE3",
"ENSEMBL:ENSSPUG00000015633"
],
"type": "biolink:id"
}
]
},
"NCBIGene:115865406": {
"category": "biolink:Gene",
"name": "BST2",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:115865406",
"name:bone marrow stromal cell antigen 2",
"SYMBOL:BST2"
],
"type": "biolink:id"
}
]
},
"NCBIGene:110132571": {
"category": "biolink:Gene",
"name": "IL1B",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:110132571",
"name:interleukin 1 beta",
"SYMBOL:IL1B"
],
"type": "biolink:id"
}
]
},
"NCBIGene:101571570": {
"category": "biolink:Gene",
"name": "Ifih1",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:101571570",
"name:interferon induced with helicase C domain 1",
"SYMBOL:Ifih1",
"ENSEMBL:ENSODEG00000013586"
],
"type": "biolink:id"
}
]
},
"ENSEMBL:ENSSMAG00000017984": {
"category": "biolink:Gene",
"name": "npc1",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"name:Niemann-Pick disease, type C1",
"SYMBOL:npc1",
"ENSEMBL:ENSSMAG00000017984"
],
"type": "biolink:id"
}
]
},
"NCBIGene:397686": {
"category": "biolink:Gene",
"name": "IFNA1",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:397686",
"name:interferon, alpha 1",
"SYMBOL:IFNA1",
"ENSEMBL:ENSSSCG00000050619"
],
"type": "biolink:id"
}
]
},
"NCBIGene:102892030": {
"category": "biolink:Gene",
"name": "ALB",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:102892030",
"name:albumin",
"SYMBOL:ALB"
],
"type": "biolink:id"
}
]
},
"NCBIGene:104045425": {
"category": "biolink:Gene",
"name": "HDX",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:104045425",
"name:highly divergent homeobox",
"SYMBOL:HDX"
],
"type": "biolink:id"
}
]
},
"NCBIGene:110137949": {
"category": "biolink:Gene",
"name": "CXCL10",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:110137949",
"name:C-X-C motif chemokine ligand 10",
"SYMBOL:CXCL10"
],
"type": "biolink:id"
}
]
},
"NCBIGene:105822820": {
"category": "biolink:Gene",
"name": "CXCL8",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:105822820",
"name:C-X-C motif chemokine ligand 8",
"SYMBOL:CXCL8",
"ENSEMBL:ENSPCOG00000024593"
],
"type": "biolink:id"
}
]
},
"NCBIGene:116479423": {
"category": "biolink:Gene",
"name": "CLEC4M",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:116479423",
"name:C-type lectin domain family 4 member M",
"SYMBOL:CLEC4M"
],
"type": "biolink:id"
}
]
},
"NCBIGene:103814882": {
"category": "biolink:Gene",
"name": "F3",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:103814882",
"name:coagulation factor III, tissue factor",
"SYMBOL:F3",
"ENSEMBL:ENSSCAG00000012591"
],
"type": "biolink:id"
}
]
},
"NCBIGene:101142722": {
"category": "biolink:Gene",
"name": "KPNA1",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:101142722",
"name:karyopherin subunit alpha 1",
"SYMBOL:KPNA1"
],
"type": "biolink:id"
}
]
},
"NCBIGene:104673720": {
"category": "biolink:Gene",
"name": "CTSL",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:104673720",
"name:cathepsin L",
"SYMBOL:CTSL",
"ENSEMBL:ENSRROG00000038398"
],
"type": "biolink:id"
}
]
},
"NCBIGene:116543050": {
"category": "biolink:Gene",
"name": "CTSB",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:116543050",
"name:cathepsin B",
"SYMBOL:CTSB"
],
"type": "biolink:id"
}
]
},
"NCBIGene:29798": {
"category": "biolink:Gene",
"name": "C2orf27A",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:29798",
"name:chromosome 2 open reading frame 27A",
"SYMBOL:C2orf27A",
"UMLS:C2681192",
"HGNC:25077",
"UniProtKB:P0DPF5"
],
"type": "biolink:id"
}
]
},
"NCBIGene:118012204": {
"category": "biolink:Gene",
"name": "STAT1",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:118012204",
"name:signal transducer and activator of transcription 1",
"SYMBOL:STAT1"
],
"type": "biolink:id"
}
]
},
"NCBIGene:101937382": {
"category": "biolink:Gene",
"name": "KPNA5",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:101937382",
"name:karyopherin subunit alpha 5",
"SYMBOL:KPNA5"
],
"type": "biolink:id"
}
]
},
"ENSEMBL:ENSNVIG00000024389": {
"category": "biolink:Gene",
"name": "IFIT2",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"name:interferon induced protein with tetratricopeptide repeats 2",
"SYMBOL:IFIT2",
"ENSEMBL:ENSNVIG00000024389"
],
"type": "biolink:id"
}
]
},
"NCBIGene:104395366": {
"category": "biolink:Gene",
"name": "THBD",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:104395366",
"name:thrombomodulin",
"SYMBOL:THBD"
],
"type": "biolink:id"
}
]
},
"NCBIGene:100731608": {
"category": "biolink:Gene",
"name": "Isg15",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:100731608",
"name:ISG15 ubiquitin like modifier",
"SYMBOL:Isg15"
],
"type": "biolink:id"
}
]
},
"NCBIGene:108529797": {
"category": "biolink:Gene",
"name": "DDX58",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:108529797",
"name:DExD/H-box helicase 58",
"SYMBOL:DDX58",
"ENSEMBL:ENSRBIG00000040257"
],
"type": "biolink:id"
}
]
},
"NCBIGene:106971145": {
"category": "biolink:Gene",
"name": "IFNB1",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:106971145",
"name:interferon beta 1",
"SYMBOL:IFNB1"
],
"type": "biolink:id"
}
]
},
"ENSEMBL:ENSCJAG00000047270": {
"category": "biolink:Gene",
"name": "GP2",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"name:glycoprotein 2",
"SYMBOL:GP2",
"ENSEMBL:ENSCJAG00000047270"
],
"type": "biolink:id"
}
]
},
"NCBIGene:101443464": {
"category": "biolink:Gene",
"name": "GPT",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:101443464",
"name:glutamic--pyruvic transaminase",
"SYMBOL:GPT"
],
"type": "biolink:id"
}
]
},
"NCBIGene:102387082": {
"category": "biolink:Gene",
"name": "IRF7",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:102387082",
"name:interferon regulatory factor 7",
"SYMBOL:IRF7"
],
"type": "biolink:id"
}
]
},
"NCBIGene:109055884": {
"category": "biolink:Gene",
"name": "il6",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:109055884",
"name:interleukin 6 (interferon, beta 2)",
"SYMBOL:il6",
"ENSEMBL:ENSCCRG00000034667"
],
"type": "biolink:id"
}
]
},
"ENSEMBL:ENSSBOG00000011322": {
"category": "biolink:Gene",
"name": "CD8A",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"name:CD8a molecule",
"SYMBOL:CD8A",
"ENSEMBL:ENSSBOG00000011322"
],
"type": "biolink:id"
}
]
},
"NCBIGene:117759282": {
"category": "biolink:Gene",
"name": "ace2",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:117759282",
"name:angiotensin I converting enzyme 2",
"SYMBOL:ace2"
],
"type": "biolink:id"
}
]
},
"NCBIGene:103562469": {
"category": "biolink:Gene",
"name": "TNF",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:103562469",
"name:tumor necrosis factor",
"SYMBOL:TNF"
],
"type": "biolink:id"
}
]
},
"NCBIGene:112648300": {
"category": "biolink:Gene",
"name": "IL10",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:112648300",
"name:interleukin 10",
"SYMBOL:IL10",
"ENSEMBL:ENSCAFG00020012434"
],
"type": "biolink:id"
}
]
},
"NCBIGene:106483620": {
"category": "biolink:Gene",
"name": "ERVW-1",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:106483620",
"name:endogenous retrovirus group W member 1, envelope",
"SYMBOL:ERVW-1"
],
"type": "biolink:id"
}
]
},
"NCBIGene:118335909": {
"category": "biolink:Gene",
"name": "irf3",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:118335909",
"name:interferon regulatory factor 3",
"SYMBOL:irf3"
],
"type": "biolink:id"
}
]
},
"NCBIGene:101674197": {
"category": "biolink:Gene",
"name": "CCL5",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:101674197",
"name:C-C motif chemokine ligand 5",
"SYMBOL:CCL5"
],
"type": "biolink:id"
}
]
},
"NCBIGene:103089296": {
"category": "biolink:Gene",
"name": "CCL3",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:103089296",
"name:C-C motif chemokine ligand 3",
"SYMBOL:CCL3"
],
"type": "biolink:id"
}
]
},
"ENSEMBL:MGP_SPRETEiJ_G0017727": {
"category": "biolink:Gene",
"name": "Ccl4",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"name:chemokine (C-C motif) ligand 4",
"SYMBOL:Ccl4",
"ENSEMBL:MGP_SPRETEiJ_G0017727"
],
"type": "biolink:id"
}
]
},
"NCBIGene:101998427": {
"category": "biolink:Gene",
"name": "Furin",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:101998427",
"name:furin, paired basic amino acid cleaving enzyme",
"SYMBOL:Furin",
"ENSEMBL:ENSMOCG00000010449"
],
"type": "biolink:id"
}
]
},
"NCBIGene:574217": {
"category": "biolink:Gene",
"name": "CCL4L1",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:574217",
"name:chemokine (C-C motif) ligand 4-like 1",
"SYMBOL:CCL4L1",
"UniProtKB:Q8HYQ2",
"ENSEMBL:ENSMMUG00000020102"
],
"type": "biolink:id"
}
]
},
"UMLS:C1707151": {
"category": "biolink:Gene",
"name": "UMLS:C1707151",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C1707151"
],
"type": "biolink:id"
}
]
},
"UMLS:C1707163": {
"category": "biolink:Gene",
"name": "UMLS:C1707163",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C1707163"
],
"type": "biolink:id"
}
]
},
"NCBIGene:3601": {
"category": "biolink:Gene",
"name": "IL15RA",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:3601",
"name:interleukin 15 receptor subunit alpha",
"SYMBOL:IL15RA",
"UMLS:C1416387",
"HGNC:5978",
"UniProtKB:Q13261",
"ENSEMBL:ENSG00000134470",
"OMIM:601070"
],
"type": "biolink:id"
}
]
},
"NCBIGene:5788": {
"category": "biolink:Gene",
"name": "PTPRC",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:5788",
"name:protein tyrosine phosphatase receptor type C",
"SYMBOL:PTPRC",
"UMLS:C1335285",
"HGNC:9666",
"UniProtKB:P08575",
"ENSEMBL:ENSG00000081237",
"ENSEMBL:ENSG00000262418",
"OMIM:151460"
],
"type": "biolink:id"
}
]
},
"NCBIGene:8030": {
"category": "biolink:Gene",
"name": "CCDC6",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:8030",
"name:coiled-coil domain containing 6",
"SYMBOL:CCDC6",
"UMLS:C1425774",
"HGNC:18782",
"UniProtKB:Q16204",
"ENSEMBL:ENSG00000108091",
"OMIM:601985"
],
"type": "biolink:id"
}
]
},
"NCBIGene:920": {
"category": "biolink:Gene",
"name": "CD4",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:920",
"name:CD4 molecule",
"SYMBOL:CD4",
"UMLS:C1332714",
"HGNC:1678",
"UniProtKB:P01730",
"ENSEMBL:ENSG00000010610",
"OMIM:186940"
],
"type": "biolink:id"
}
]
},
"NCBIGene:1514": {
"category": "biolink:Gene",
"name": "CTSL",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:1514",
"name:cathepsin L",
"SYMBOL:CTSL",
"UMLS:C1332807",
"UMLS:C0054871",
"HGNC:2537",
"UniProtKB:P07711",
"ENSEMBL:ENSG00000135047",
"OMIM:116880"
],
"type": "biolink:id"
}
]
},
"UMLS:C1706438": {
"category": "biolink:Gene",
"name": "UMLS:C1706438",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C1706438"
],
"type": "biolink:id"
}
]
},
"UMLS:C1367471": {
"category": "biolink:Gene",
"name": "UMLS:C1367471",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C1367471"
],
"type": "biolink:id"
}
]
},
"MESH:C480354": {
"category": "biolink:ChemicalSubstance",
"name": "BH30sucMan",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C1433528",
"MESH:C480354",
"name:BH30sucMan"
],
"type": "biolink:id"
}
]
},
"CHEBI:134722": {
"category": "biolink:ChemicalSubstance",
"name": "FAVIPIRAVIR",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEMBL.COMPOUND:CHEMBL221722",
"DRUGBANK:DB12466",
"PUBCHEM.COMPOUND:492405",
"CHEBI:134722",
"UMLS:C1138226",
"MESH:C462182",
"UNII:EW5GL2X7E0",
"INCHIKEY:ZCGNOVWYSGBHAU-UHFFFAOYSA-N",
"INCHI:InChI=1S/C5H4FN3O2/c6-2-1-8-5(11)3(9-2)4(7)10/h1H,(H2,7,10)(H,8,11)",
"name:FAVIPIRAVIR",
"name:Favipiravir",
"name:favipiravir"
],
"type": "biolink:id"
}
]
},
"MESH:C517546": {
"category": "biolink:ChemicalSubstance",
"name": "immucillin A",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C1870231",
"MESH:C517546",
"name:immucillin A",
"name:immucillin-A"
],
"type": "biolink:id"
}
]
},
"MESH:C487484": {
"category": "biolink:ChemicalSubstance",
"name": "K11777",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C1456738",
"MESH:C487484",
"name:K11777"
],
"type": "biolink:id"
}
]
},
"MESH:C000606551": {
"category": "biolink:ChemicalSubstance",
"name": "GS-5734",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C4279131",
"MESH:C000606551",
"name:GS-5734"
],
"type": "biolink:id"
}
]
},
"CHEBI:29687": {
"category": "biolink:ChemicalSubstance",
"name": "TEICOPLANIN",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEMBL.COMPOUND:CHEMBL2367892",
"DRUGBANK:DB06149",
"PUBCHEM.COMPOUND:73348316",
"PUBCHEM.COMPOUND:16131923",
"CHEBI:29687",
"UMLS:C0145106",
"MESH:D017334",
"UNII:4U3D3YY81M",
"INCHI:InChI=1S/C80H81Cl2N9O33/c1-26(95)84-59-65(104)62(101)50(23-92)120-78(59)123-69-31-6-10-45(40(82)16-31)118-49-19-33-18-48(70(49)124-79-60(85-27(2)96)66(105)63(102)51(24-93)121-79)117-44-9-3-28(11-39(44)81)12-41-71(108)87-56(32-13-34(97)20-36(14-32)116-46-17-29(4-8-43(46)100)54(83)72(109)86-41)74(111)89-57(33)75(112)88-55-30-5-7-42(99)37(15-30)53-38(58(77(114)115)90-76(113)61(69)91-73(55)110)21-35(98)22-47(53)119-80-68(107)67(106)64(103)52(25-94)122-80/h3-11,13-22,41,50-52,54-69,78-80,92-94,97-107H,12,23-25,83H2,1-2H3,(H,84,95)(H,85,96)(H,86,109)(H,87,108)(H,88,112)(H,89,111)(H,90,113)(H,91,110)(H,114,115)/t41-,50+,51+,52-,54-,55-,56+,57-,58+,59+,60+,61+,62-,63-,64-,65-,66-,67-,68+,69-,78+,79+,80+/m1/s1",
"name:TEICOPLANIN"
],
"type": "biolink:id"
}
]
},
"NCBIGene:3439": {
"category": "biolink:Gene",
"name": "IFNA1",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"NCBIGene:3439",
"name:interferon alpha 1",
"SYMBOL:IFNA1",
"UMLS:C1415900",
"HGNC:5417",
"UniProtKB:P01562",
"ENSEMBL:ENSG00000197919",
"OMIM:147660"
],
"type": "biolink:id"
}
]
},
"UMLS:C1708411": {
"category": "biolink:Gene",
"name": "UMLS:C1708411",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C1708411"
],
"type": "biolink:id"
}
]
},
"UMLS:C0017337": {
"category": "biolink:Gene",
"name": "UMLS:C0017337",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C0017337"
],
"type": "biolink:id"
}
]
},
"UMLS:C1335439": {
"category": "biolink:Gene",
"name": "UMLS:C1335439",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"UMLS:C1335439"
],
"type": "biolink:id"
}
]
},
"CHEBI:50312": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:50312",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:50312"
],
"type": "biolink:id"
}
]
},
"CHEBI:22658": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:22658",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:22658"
],
"type": "biolink:id"
}
]
},
"CHEBI:33285": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:33285",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:33285"
],
"type": "biolink:id"
}
]
},
"CHEBI:36876": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:36876",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:36876"
],
"type": "biolink:id"
}
]
},
"CHEBI:76668": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:76668",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:76668"
],
"type": "biolink:id"
}
]
},
"CHEBI:26082": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:26082",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:26082"
],
"type": "biolink:id"
}
]
},
"CHEBI:19255": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:19255",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:19255"
],
"type": "biolink:id"
}
]
},
"CHEBI:23523": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:23523",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:23523"
],
"type": "biolink:id"
}
]
},
"CHEBI:27644": {
"category": "biolink:ChemicalSubstance",
"name": "CHLORTETRACYCLINE",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEMBL.COMPOUND:CHEMBL404520",
"CHEMBL.COMPOUND:CHEMBL2146063",
"DRUGBANK:DB09093",
"PUBCHEM.COMPOUND:54708735",
"PUBCHEM.COMPOUND:54675777",
"CHEBI:27644",
"UMLS:C0008293",
"MESH:D002751",
"UNII:O1GX33ON8R",
"UNII:WCK1KIQ23Q",
"INCHIKEY:CYDMQBQPVICBEU-XRNKAMNCSA-N",
"INCHI:InChI=1S/C22H23ClN2O8/c1-21(32)7-6-8-15(25(2)3)17(28)13(20(24)31)19(30)22(8,33)18(29)11(7)16(27)12-10(26)5-4-9(23)14(12)21/h4-5,7-8,15,26,28-29,32-33H,6H2,1-3H3,(H2,24,31)/t7-,8-,15-,21-,22-/m0/s1",
"KEGG:C06571",
"name:CHLORTETRACYCLINE",
"name:Chlortetracycline",
"name:chlortetracycline"
],
"type": "biolink:id"
}
]
},
"CHEBI:26004": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:26004",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:26004"
],
"type": "biolink:id"
}
]
},
"CHEBI:47040": {
"category": "biolink:ChemicalSubstance",
"name": "lipid A",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:47040",
"name:lipid A"
],
"type": "biolink:id"
}
]
},
"CHEBI:18085": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:18085",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:18085"
],
"type": "biolink:id"
}
]
},
"CHEBI:24610": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:24610",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:24610"
],
"type": "biolink:id"
}
]
},
"CHEBI:32588": {
"category": "biolink:ChemicalSubstance",
"name": "POTASSIUM CHLORIDE",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEMBL.COMPOUND:CHEMBL1200731",
"DRUGBANK:DB00761",
"PUBCHEM.COMPOUND:4873",
"CHEBI:32588",
"UMLS:C0032825",
"MESH:D011189",
"UNII:660YQ98I10",
"INCHIKEY:WCUXLLCKKVVCTQ-UHFFFAOYSA-M",
"INCHI:InChI=1S/ClH.K/h1H;/q;+1/p-1",
"name:POTASSIUM CHLORIDE",
"name:Potassium chloride",
"name:Potassium Chloride",
"name:potassium chloride"
],
"type": "biolink:id"
}
]
},
"CHEBI:53662": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:53662",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:53662"
],
"type": "biolink:id"
}
]
},
"CHEBI:26872": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:26872",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:26872"
],
"type": "biolink:id"
}
]
},
"CHEBI:25527": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:25527",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:25527"
],
"type": "biolink:id"
}
]
},
"CHEBI:18179": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:18179",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:18179"
],
"type": "biolink:id"
}
]
},
"CHEBI:51475": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:51475",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:51475"
],
"type": "biolink:id"
}
]
},
"CHEBI:76938": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:76938",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:76938"
],
"type": "biolink:id"
}
]
},
"CHEBI:35785": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:35785",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:35785"
],
"type": "biolink:id"
}
]
},
"CHEBI:6495": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:6495",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:6495"
],
"type": "biolink:id"
}
]
},
"CHEBI:23521": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:23521",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:23521"
],
"type": "biolink:id"
}
]
},
"CHEBI:37581": {
"category": "biolink:ChemicalSubstance",
"name": "gamma-lactone",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:37581",
"name:gamma-lactone"
],
"type": "biolink:id"
}
]
},
"CHEBI:36711": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:36711",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:36711"
],
"type": "biolink:id"
}
]
},
"CHEBI:168396": {
"category": "biolink:ChemicalSubstance",
"name": "MYCOPHENOLIC ACID",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEMBL.COMPOUND:CHEMBL866",
"CHEMBL.COMPOUND:CHEMBL2106643",
"DRUGBANK:DB01024",
"PUBCHEM.COMPOUND:446541",
"CHEBI:168396",
"UMLS:C0883242",
"UMLS:C0026933",
"MESH:D009173",
"UNII:HU9DX48N0T",
"INCHIKEY:HPNSFSBZBAHARI-RUDMXATFSA-N",
"INCHI:InChI=1S/C17H20O6/c1-9(5-7-13(18)19)4-6-11-15(20)14-12(8-23-17(14)21)10(2)16(11)22-3/h4,20H,5-8H2,1-3H3,(H,18,19)/b9-4+",
"name:MYCOPHENOLIC ACID",
"name:Mycophenolic acid",
"name:Mycophenolic Acid",
"name:mycophenolic acid"
],
"type": "biolink:id"
}
]
},
"CHEBI:35284": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:35284",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:35284"
],
"type": "biolink:id"
}
]
},
"CHEBI:36044": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:36044",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:36044"
],
"type": "biolink:id"
}
]
},
"CHEBI:50313": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:50313",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:50313"
],
"type": "biolink:id"
}
]
},
"CHEBI:76759": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:76759",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:76759"
],
"type": "biolink:id"
}
]
},
"CHEBI:61296": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:61296",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:61296"
],
"type": "biolink:id"
}
]
},
"CHEBI:73474": {
"category": "biolink:ChemicalSubstance",
"name": "acetylenic compound",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:73474",
"name:acetylenic compound"
],
"type": "biolink:id"
}
]
},
"CHEBI:18295": {
"category": "biolink:ChemicalSubstance",
"name": "HISTAMINE",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEMBL.COMPOUND:CHEMBL90",
"CHEMBL.COMPOUND:CHEMBL535166",
"CHEMBL.COMPOUND:CHEMBL1200801",
"CHEMBL.COMPOUND:CHEMBL1533310",
"DRUGBANK:DB05381",
"PUBCHEM.COMPOUND:774",
"CHEBI:18295",
"UMLS:C0019588",
"MESH:D006632",
"UNII:3POA0Q644U",
"UNII:820484N8I3",
"INCHIKEY:NTYJJOPFIAHURM-UHFFFAOYSA-N",
"INCHI:InChI=1S/C5H9N3/c6-2-1-5-3-7-4-8-5/h3-4H,1-2,6H2,(H,7,8)",
"KEGG:C00388",
"name:HISTAMINE",
"name:Histamine",
"name:histamine"
],
"type": "biolink:id"
}
]
},
"CHEBI:24261": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:24261",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:24261"
],
"type": "biolink:id"
}
]
},
"CHEBI:22213": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:22213",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:22213"
],
"type": "biolink:id"
}
]
},
"CHEBI:38166": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:38166",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:38166"
],
"type": "biolink:id"
}
]
},
"CHEBI:33676": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:33676",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:33676"
],
"type": "biolink:id"
}
]
},
"CHEBI:33308": {
"category": "biolink:ChemicalSubstance",
"name": "carboxylic ester",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:33308",
"name:carboxylic ester"
],
"type": "biolink:id"
}
]
},
"CHEBI:25693": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:25693",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:25693"
],
"type": "biolink:id"
}
]
},
"CHEBI:32874": {
"category": "biolink:ChemicalSubstance",
"name": "proline residue",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:32874",
"name:proline residue"
],
"type": "biolink:id"
}
]
},
"CHEBI:35381": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:35381",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:35381"
],
"type": "biolink:id"
}
]
},
"CHEBI:32535": {
"category": "biolink:ChemicalSubstance",
"name": "histidine residue",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:32535",
"name:histidine residue"
],
"type": "biolink:id"
}
]
},
"CHEBI:36807": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:36807",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:36807"
],
"type": "biolink:id"
}
]
},
"CHEBI:48433": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:48433",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:48433"
],
"type": "biolink:id"
}
]
},
"CHEBI:50047": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:50047",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:50047"
],
"type": "biolink:id"
}
]
},
"CHEBI:29917": {
"category": "biolink:ChemicalSubstance",
"name": "thiol group",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:29917",
"name:thiol group"
],
"type": "biolink:id"
}
]
},
"CHEBI:30185": {
"category": "biolink:ChemicalSubstance",
"name": "Zinc",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEMBL.COMPOUND:CHEMBL1201279",
"DRUGBANK:DB01593",
"PUBCHEM.COMPOUND:23994",
"CHEBI:30185",
"CHEBI:27363",
"UMLS:C0043481",
"MESH:D015032",
"UNII:J41CSQ7QDS",
"INCHIKEY:HCHKCACWOHOZIP-UHFFFAOYSA-N",
"INCHI:InChI=1S/Zn",
"KEGG:C00038",
"name:Zinc",
"name:ZINC",
"name:zinc",
"name:zinc(0)",
"name:zinc atom"
],
"type": "biolink:id"
}
]
},
"CHEBI:67079": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:67079",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:67079"
],
"type": "biolink:id"
}
]
},
"CHEBI:26738": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:26738",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:26738"
],
"type": "biolink:id"
}
]
},
"CHEBI:2639": {
"category": "biolink:ChemicalSubstance",
"name": "AMILORIDE",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEMBL.COMPOUND:CHEMBL945",
"CHEMBL.COMPOUND:CHEMBL1398126",
"DRUGBANK:DB00594",
"PUBCHEM.COMPOUND:16231",
"CHEBI:2639",
"UMLS:C0002502",
"MESH:D000584",
"UNII:7DZO8EB0Z3",
"INCHIKEY:XSDQTOBWRPYKKA-UHFFFAOYSA-N",
"INCHI:InChI=1S/C6H8ClN7O/c7-2-4(9)13-3(8)1(12-2)5(15)14-6(10)11/h(H4,8,9,13)(H4,10,11,14,15)",
"KEGG:C06821",
"name:AMILORIDE",
"name:Amiloride",
"name:amiloride"
],
"type": "biolink:id"
}
]
},
"CHEBI:38338": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:38338",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:38338"
],
"type": "biolink:id"
}
]
},
"CHEBI:47885": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:47885",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:47885"
],
"type": "biolink:id"
}
]
},
"CHEBI:35868": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:35868",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:35868"
],
"type": "biolink:id"
}
]
},
"CHEBI:52396": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:52396",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:52396"
],
"type": "biolink:id"
}
]
},
"CHEBI:26873": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:26873",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:26873"
],
"type": "biolink:id"
}
]
},
"CHEBI:61538": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:61538",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:61538"
],
"type": "biolink:id"
}
]
},
"CHEBI:53105": {
"category": "biolink:ChemicalSubstance",
"name": "UMP 5'-end residue",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:53105",
"name:UMP 5'-end residue"
],
"type": "biolink:id"
}
]
},
"CHEBI:33579": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:33579",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:33579"
],
"type": "biolink:id"
}
]
},
"CHEBI:76939": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:76939",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:76939"
],
"type": "biolink:id"
}
]
},
"CHEBI:16042": {
"category": "biolink:ChemicalSubstance",
"name": "halide anion",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:16042",
"name:halide anion"
],
"type": "biolink:id"
}
]
},
"CHEBI:35478": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:35478",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:35478"
],
"type": "biolink:id"
}
]
},
"CHEBI:33318": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:33318",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:33318"
],
"type": "biolink:id"
}
]
},
"CHEBI:53325": {
"category": "biolink:ChemicalSubstance",
"name": "nitrocellulose",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:53325",
"name:nitrocellulose"
],
"type": "biolink:id"
}
]
},
"CHEBI:36683": {
"category": "biolink:ChemicalSubstance",
"name": "organochlorine compound",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:36683",
"name:organochlorine compound"
],
"type": "biolink:id"
}
]
},
"CHEBI:24400": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:24400",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:24400"
],
"type": "biolink:id"
}
]
},
"CHEBI:49319": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:49319",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:49319"
],
"type": "biolink:id"
}
]
},
"CHEBI:72695": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:72695",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:72695"
],
"type": "biolink:id"
}
]
},
"CHEBI:48001": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:48001",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:48001"
],
"type": "biolink:id"
}
]
},
"CHEBI:50320": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:50320",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:50320"
],
"type": "biolink:id"
}
]
},
"CHEBI:63409": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:63409",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:63409"
],
"type": "biolink:id"
}
]
},
"CHEBI:82852": {
"category": "biolink:ChemicalSubstance",
"name": "inosine 5'-phosphate(1-) residue",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:82852",
"name:inosine 5'-phosphate(1-) residue"
],
"type": "biolink:id"
}
]
},
"CHEBI:24532": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:24532",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:24532"
],
"type": "biolink:id"
}
]
},
"CHEBI:16670": {
"category": "biolink:ChemicalSubstance",
"name": "peptide",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:16670",
"name:peptide"
],
"type": "biolink:id"
}
]
},
"CHEBI:28304": {
"category": "biolink:ChemicalSubstance",
"name": "Heparin",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEMBL.COMPOUND:CHEMBL1201513",
"CHEMBL.COMPOUND:CHEMBL1201657",
"CHEMBL.COMPOUND:CHEMBL1909300",
"DRUGBANK:DB01109",
"PUBCHEM.COMPOUND:772",
"CHEBI:28304",
"UMLS:C0770546",
"UMLS:C0019134",
"MESH:D006493",
"UNII:M4F288ZCTR",
"name:Heparin"
],
"type": "biolink:id"
}
]
},
"CHEBI:33317": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:33317",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:33317"
],
"type": "biolink:id"
}
]
},
"CHEBI:31624": {
"category": "biolink:ChemicalSubstance",
"name": "FLUORESCEIN SODIUM",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEMBL.COMPOUND:CHEMBL1628233",
"CHEMBL.COMPOUND:CHEMBL177756",
"DRUGBANK:DB00693",
"PUBCHEM.COMPOUND:10608",
"PUBCHEM.COMPOUND:16850",
"CHEBI:31624",
"UMLS:C0060520",
"MESH:D019793",
"UNII:93X55PE38X",
"INCHIKEY:NJDNXYGOVLYJHP-UHFFFAOYSA-L",
"INCHI:InChI=1S/C20H12O5.2Na/c21-11-5-7-15-17(9-11)25-18-10-12(22)6-8-16(18)19(15)13-3-1-2-4-14(13)20(23)24;;/h1-10,21H,(H,23,24);;/q;2*+1/p-2",
"name:FLUORESCEIN SODIUM"
],
"type": "biolink:id"
}
]
},
"CHEBI:20706": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:20706",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:20706"
],
"type": "biolink:id"
}
]
},
"CHEBI:51061": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:51061",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:51061"
],
"type": "biolink:id"
}
]
},
"CHEBI:33482": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:33482",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:33482"
],
"type": "biolink:id"
}
]
},
"CHEBI:26632": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:26632",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:26632"
],
"type": "biolink:id"
}
]
},
"CHEBI:61692": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:61692",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:61692"
],
"type": "biolink:id"
}
]
},
"CHEBI:53113": {
"category": "biolink:ChemicalSubstance",
"name": "dAMP 3'-end residue",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:53113",
"name:dAMP 3'-end residue"
],
"type": "biolink:id"
}
]
},
"CHEBI:26912": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:26912",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:26912"
],
"type": "biolink:id"
}
]
},
"CHEBI:63962": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:63962",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:63962"
],
"type": "biolink:id"
}
]
},
"CHEBI:38215": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:38215",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:38215"
],
"type": "biolink:id"
}
]
},
"CHEBI:23213": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:23213",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:23213"
],
"type": "biolink:id"
}
]
},
"CHEBI:33298": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:33298",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:33298"
],
"type": "biolink:id"
}
]
},
"CHEBI:33563": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:33563",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:33563"
],
"type": "biolink:id"
}
]
},
"CHEBI:50308": {
"category": "biolink:ChemicalSubstance",
"name": "cytidine 5'-monophosphate residue",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:50308",
"name:cytidine 5'-monophosphate residue"
],
"type": "biolink:id"
}
]
},
"CHEBI:35724": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:35724",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:35724"
],
"type": "biolink:id"
}
]
},
"CHEBI:35416": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:35416",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:35416"
],
"type": "biolink:id"
}
]
},
"CHEBI:37247": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:37247",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:37247"
],
"type": "biolink:id"
}
]
},
"CHEBI:33458": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:33458",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:33458"
],
"type": "biolink:id"
}
]
},
"CHEBI:50306": {
"category": "biolink:ChemicalSubstance",
"name": "adenosine 5'-monophosphate residue",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:50306",
"name:adenosine 5'-monophosphate residue"
],
"type": "biolink:id"
}
]
},
"CHEBI:36389": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:36389",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:36389"
],
"type": "biolink:id"
}
]
},
"CHEBI:17568": {
"category": "biolink:ChemicalSubstance",
"name": "URACIL",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEMBL.COMPOUND:CHEMBL566",
"DRUGBANK:DB03419",
"PUBCHEM.COMPOUND:1174",
"CHEBI:17568",
"UMLS:C0041917",
"MESH:D014498",
"UNII:56HH86ZVCT",
"INCHIKEY:ISAKRJDGNUQOIC-UHFFFAOYSA-N",
"INCHI:InChI=1S/C4H4N2O2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8)",
"KEGG:C00106",
"name:URACIL",
"name:Uracil",
"name:uracil"
],
"type": "biolink:id"
}
]
},
"CHEBI:50753": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:50753",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:50753"
],
"type": "biolink:id"
}
]
},
"CHEBI:24898": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:24898",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:24898"
],
"type": "biolink:id"
}
]
},
"CHEBI:33504": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:33504",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:33504"
],
"type": "biolink:id"
}
]
},
"CHEBI:26191": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:26191",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:26191"
],
"type": "biolink:id"
}
]
},
"CHEBI:139592": {
"category": "biolink:ChemicalSubstance",
"name": "tertiary alpha-hydroxy ketone",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:139592",
"name:tertiary alpha-hydroxy ketone"
],
"type": "biolink:id"
}
]
},
"CHEBI:22314": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:22314",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:22314"
],
"type": "biolink:id"
}
]
},
"CHEBI:17996": {
"category": "biolink:ChemicalSubstance",
"name": "Chloride ion",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEMBL.COMPOUND:CHEMBL19429",
"DRUGBANK:DB14547",
"PUBCHEM.COMPOUND:312",
"CHEBI:17996",
"UNII:Q32ZN48698",
"INCHIKEY:VEXZGXHMUGYJMC-UHFFFAOYSA-M",
"INCHI:InChI=1S/ClH/h1H/p-1",
"KEGG:C00698",
"name:Chloride ion",
"name:CHLORIDE ION",
"name:chloride"
],
"type": "biolink:id"
}
]
},
"CHEBI:37404": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:37404",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:37404"
],
"type": "biolink:id"
}
]
},
"CHEBI:85264": {
"category": "biolink:ChemicalSubstance",
"name": "CLAVULANATE POTASSIUM",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEMBL.COMPOUND:CHEMBL1003",
"DRUGBANK:DB00766",
"PUBCHEM.COMPOUND:23665591",
"CHEBI:85264",
"UNII:Q42OMW3AT8",
"INCHIKEY:ABVRVIZBZKUTMK-JSYANWSFSA-M",
"INCHI:InChI=1S/C8H9NO5.K/c10-2-1-4-7(8(12)13)9-5(11)3-6(9)14-4;/h1,6-7,10H,2-3H2,(H,12,13);/q;+1/p-1/b4-1-;/t6-,7-;/m1./s1",
"name:CLAVULANATE POTASSIUM",
"name:potassium clavulanate"
],
"type": "biolink:id"
}
]
},
"CHEBI:60766": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:60766",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:60766"
],
"type": "biolink:id"
}
]
},
"CHEBI:64654": {
"category": "biolink:ChemicalSubstance",
"name": "guanosine residue",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:64654",
"name:guanosine residue"
],
"type": "biolink:id"
}
]
},
"CHEBI:32835": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:32835",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:32835"
],
"type": "biolink:id"
}
]
},
"CHEBI:33543": {
"category": "biolink:ChemicalSubstance",
"name": "sulfonate",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"PUBCHEM.COMPOUND:656472",
"CHEBI:33543",
"INCHIKEY:BDHFUVZGWQCTTF-UHFFFAOYSA-M",
"INCHI:InChI=1S/H2O3S/c1-4(2)3/h4H,(H,1,2,3)/p-1",
"name:sulfonate"
],
"type": "biolink:id"
}
]
},
"CHEBI:22702": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:22702",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:22702"
],
"type": "biolink:id"
}
]
},
"CHEBI:60027": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:60027",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:60027"
],
"type": "biolink:id"
}
]
},
"CHEBI:59941": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:59941",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:59941"
],
"type": "biolink:id"
}
]
},
"CHEBI:35350": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:35350",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:35350"
],
"type": "biolink:id"
}
]
},
"CHEBI:25384": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:25384",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:25384"
],
"type": "biolink:id"
}
]
},
"CHEBI:33570": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:33570",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:33570"
],
"type": "biolink:id"
}
]
},
"CHEBI:53103": {
"category": "biolink:ChemicalSubstance",
"name": "CMP 5'-end residue",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:53103",
"name:CMP 5'-end residue"
],
"type": "biolink:id"
}
]
},
"CHEBI:33620": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:33620",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:33620"
],
"type": "biolink:id"
}
]
},
"CHEBI:42191": {
"category": "biolink:ChemicalSubstance",
"name": "EDETIC ACID",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEMBL.COMPOUND:CHEMBL858",
"CHEMBL.COMPOUND:CHEMBL1749",
"CHEMBL.COMPOUND:CHEMBL1200375",
"DRUGBANK:DB00974",
"PUBCHEM.COMPOUND:6049",
"CHEBI:42191",
"UMLS:C0012695",
"UMLS:C0013618",
"UMLS:C0006692",
"MESH:D004492",
"UNII:25IH6R4SGF",
"UNII:9G34HU7RV0",
"INCHIKEY:KCXVZYZYPLLWCC-UHFFFAOYSA-N",
"INCHI:InChI=1S/C10H16N2O8/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20)",
"KEGG:C00284",
"name:EDETIC ACID",
"name:Edetic acid",
"name:Calcium Disodium Edetate",
"name:edetic acid",
"name:ethylenediaminetetraacetic acid"
],
"type": "biolink:id"
}
]
},
"CHEBI:26822": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:26822",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:26822"
],
"type": "biolink:id"
}
]
},
"CHEBI:61120": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:61120",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:61120"
],
"type": "biolink:id"
}
]
},
"CHEBI:33581": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:33581",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:33581"
],
"type": "biolink:id"
}
]
},
"CHEBI:33459": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:33459",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:33459"
],
"type": "biolink:id"
}
]
},
"CHEBI:22718": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:22718",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:22718"
],
"type": "biolink:id"
}
]
},
"CHEBI:27369": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:27369",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:27369"
],
"type": "biolink:id"
}
]
},
"CHEBI:27140": {
"category": "biolink:ChemicalSubstance",
"name": "OXYGEN",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEMBL.COMPOUND:CHEMBL1234886",
"DRUGBANK:DB09140",
"PUBCHEM.COMPOUND:977",
"CHEBI:27140",
"CHEBI:26689",
"CHEBI:15379",
"CHEBI:25805",
"UMLS:C0030054",
"MESH:D010100",
"UNII:S88TT14065",
"INCHIKEY:MYMOFIZGZYHOMD-UHFFFAOYSA-N",
"INCHI:InChI=1S/O2/c1-2",
"KEGG:C00007",
"name:OXYGEN",
"name:Oxygen",
"name:triplet dioxygen",
"name:singlet dioxygen",
"name:dioxygen"
],
"type": "biolink:id"
}
]
},
"CHEBI:38755": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:38755",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:38755"
],
"type": "biolink:id"
}
]
},
"CHEBI:33282": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:33282",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:33282"
],
"type": "biolink:id"
}
]
},
"CHEBI:33304": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:33304",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:33304"
],
"type": "biolink:id"
}
]
},
"CHEBI:59132": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:59132",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:59132"
],
"type": "biolink:id"
}
]
},
"CHEBI:33702": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:33702",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:33702"
],
"type": "biolink:id"
}
]
},
"CHEBI:36830": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:36830",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:36830"
],
"type": "biolink:id"
}
]
},
"CHEBI:9566": {
"category": "biolink:ChemicalSubstance",
"name": "THIORIDAZINE",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEMBL.COMPOUND:CHEMBL479",
"CHEMBL.COMPOUND:CHEMBL1200916",
"DRUGBANK:DB00679",
"PUBCHEM.COMPOUND:5452",
"CHEBI:9566",
"UMLS:C0039943",
"UMLS:C0025225",
"MESH:D013881",
"UNII:4WCI67NK8M",
"UNII:N3D6TG58NI",
"INCHIKEY:KLBQZWRITKRQQV-UHFFFAOYSA-N",
"INCHI:InChI=1S/C21H26N2S2/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)25-21-11-10-17(24-2)15-19(21)23/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3",
"name:THIORIDAZINE",
"name:Thioridazine",
"name:Sonapax",
"name:thioridazine"
],
"type": "biolink:id"
}
]
},
"CHEBI:73477": {
"category": "biolink:ChemicalSubstance",
"name": "terminal acetylenic compound",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:73477",
"name:terminal acetylenic compound"
],
"type": "biolink:id"
}
]
},
"CHEBI:24436": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:24436",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:24436"
],
"type": "biolink:id"
}
]
},
"CHEBI:50843": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:50843",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:50843"
],
"type": "biolink:id"
}
]
},
"CHEBI:53116": {
"category": "biolink:ChemicalSubstance",
"name": "CMP 3'-end residue",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:53116",
"name:CMP 3'-end residue"
],
"type": "biolink:id"
}
]
},
"CHEBI:33711": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:33711",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:33711"
],
"type": "biolink:id"
}
]
},
"CHEBI:22726": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:22726",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:22726"
],
"type": "biolink:id"
}
]
},
"CHEBI:31577": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:31577",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:31577"
],
"type": "biolink:id"
}
]
},
"CHEBI:22256": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:22256",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:22256"
],
"type": "biolink:id"
}
]
},
"CHEBI:60258": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:60258",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:60258"
],
"type": "biolink:id"
}
]
},
"CHEBI:33300": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:33300",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:33300"
],
"type": "biolink:id"
}
]
},
"CHEBI:35274": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:35274",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:35274"
],
"type": "biolink:id"
}
]
},
"CHEBI:37750": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:37750",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:37750"
],
"type": "biolink:id"
}
]
},
"CHEBI:51151": {
"category": "biolink:ChemicalSubstance",
"name": "CHEBI:51151",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:51151"
],
"type": "biolink:id"
}
]
},
"CHEBI:50300": {
"category": "biolink:ChemicalSubstance",
"name": "thymidine 5'-monophosphate residue",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"CHEBI:50300",
"name:thymidine 5'-monophosphate residue"
],
"type": "biolink:id"
}
]
},
"CHEBI:33629": {
"category": "biolink:ChemicalSubstance",
"name": "Aluminium",
"attributes": [
{
"name": "equivalent_identifiers",
"value": [
"DRUGBANK:DB01370",
"PUBCHEM.COMPOUND:5359268",
"CHEBI:33629",
"CHEBI:28984",
"UMLS:C0002367",
"MESH:D000535",
"UNII:CPD4NFA903",
"INCHIKEY:XAGFODPZIPBFFR-UHFFFAOYSA-N",
"INCHI:InChI=1S/Al",
"KEGG:C06264",
"name:Aluminium",
"name:Aluminum",
"name:ALUMINUM",